![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/unknown.gif) | SP421PS.part3.rar | 2021-08-21 05:00 | 1.3G | |
![[DIR]](/icons/folder.gif) | Bride wars/ | 2022-01-21 03:05 | - | |
| La Leyenda De Bagger Vance/ | 2022-01-22 05:39 | - | |
| Benedetta/ | 2022-01-22 17:05 | - | |
| Munich The Edge of War/ | 2022-01-22 17:05 | - | |
| The Jesus Rolls/ | 2022-01-22 17:05 | - | |
| El violín de mi padre/ | 2022-01-22 17:27 | - | |
| The Electrical Life of Louis Wain/ | 2022-01-22 23:50 | - | |
| MI HIJO/ | 2022-01-22 23:50 | - | |
| Sucker Punch/ | 2022-01-24 06:02 | - | |
| A Hero (2021)/ | 2022-01-26 18:44 | - | |
| Reunion (2020)/ | 2022-01-26 18:44 | - | |
| Memoria (2021)/ | 2022-01-26 18:44 | - | |
| Code of Silence (2021) CAM/ | 2022-01-26 18:44 | - | |
| South of Heaven (2021)/ | 2022-01-26 18:44 | - | |
| Harry and Meghan Escaping the Palace (2021)/ | 2022-01-26 18:44 | - | |
| Mediterráneo (2021)/ | 2022-01-26 19:00 | - | |
| he Legend of La Llorona (2022)/ | 2022-01-26 19:03 | - | |
| El perro que no calla (2021)/ | 2022-01-26 19:04 | - | |
| om and Jerry Cowboy Up! (2022)/ | 2022-01-26 19:07 | - | |
| el rey leon/ | 2022-01-26 23:07 | - | |
| The Lincoln Lawyer (Culpable o inocente) (2011)/ | 2022-01-27 00:29 | - | |
| Aziz Ansari Nightclub Comedian/ | 2022-01-27 03:31 | - | |
| Run Hide Fight/ | 2022-01-27 03:31 | - | |
| Sharkwater/ | 2022-01-27 03:31 | - | |
| Triumph/ | 2022-01-27 03:31 | - | |
| Private Desert/ | 2022-01-27 03:31 | - | |
| Perfecto Anfitrión/ | 2022-01-27 04:40 | - | |
| La Forma del bosque/ | 2022-01-27 04:57 | - | |
| EXCASADOS/ | 2022-01-27 04:57 | - | |
| VOTAMOS/ | 2022-01-27 04:57 | - | |
| Fever Pitch/ | 2022-01-27 06:34 | - | |
| Ong Bak/ | 2022-01-28 00:45 | - | |
| The Fallout/ | 2022-01-29 05:35 | - | |
| Agentes 355/ | 2022-01-30 00:35 | - | |
| Home Team (Jugar en casa) (2022)/ | 2022-01-30 19:07 | - | |
| It. Chapter/ | 2022-02-01 18:07 | - | |
| House Of Gucci (2021) [720p]/ | 2022-02-01 22:04 | - | |
| Lacci (Lazos) (2020)/ | 2022-02-09 01:31 | - | |
| Mr. Zoo The Missing VIP (2020)/ | 2022-02-09 01:31 | - | |
| Looop Lapeta (Un bucle sin fin) (2022)/ | 2022-02-09 01:31 | - | |
| Yi miao zhong (One Second) (2020)/ | 2022-02-09 01:31 | - | |
| Sexo, pudor y lágrimas 2 (2022)/ | 2022-02-09 01:31 | - | |
| The Winter Lake (2020)/ | 2022-02-09 01:31 | - | |
| The Curse of La Patasola (2022)/ | 2022-02-09 01:49 | - | |
| Gott, du kannst ein Arsch sein (God, You’re Such a Prick) (2020)/ | 2022-02-09 01:51 | - | |
| Old Henry (2021)/ | 2022-02-09 01:53 | - | |
| Damon’s Revenge (2022)/ | 2022-02-09 01:54 | - | |
| You’re Bacon Me Crazy (2020)/ | 2022-02-09 01:59 | - | |
| Roads to Olympia (Los caminos a Olimpia) (2019)/ | 2022-02-09 02:02 | - | |
| Immanence (2022)/ | 2022-02-09 02:05 | - | |
| O Melhor Verão das Nossas Vidas (2020)/ | 2022-02-09 02:12 | - | |
| Entropy (2022)/ | 2022-02-09 02:17 | - | |
| Queen of Spades (2021)/ | 2022-02-09 02:56 | - | |
| Petra de San José (2021)/ | 2022-02-09 02:56 | - | |
| Playing Cupid (2021)/ | 2022-02-09 02:56 | - | |
| Flashback (2021)/ | 2022-02-09 02:57 | - | |
| A través de mi ventana (2022)/ | 2022-02-09 02:57 | - | |
| Den største forbrytelsen (Betrayed) (2020)/ | 2022-02-09 03:15 | - | |
| The Exchange (2021)/ | 2022-02-09 03:16 | - | |
| Jekyll and Hyde (2021)/ | 2022-02-09 03:17 | - | |
| La bonne épouse (2020)/ | 2022-02-09 03:20 | - | |
| The Kings Man/ | 2022-02-09 18:39 | - | |
| Leave No Traces (2021)/ | 2022-02-10 21:04 | - | |
| Nightmare Alley (El callejón de las almas perdidas) (2021)/ | 2022-02-10 21:04 | - | |
| Hors normes (2019)/ | 2022-02-10 21:04 | - | |
| American Underdog (2021)/ | 2022-02-10 21:04 | - | |
| Found Wandering Lost (2022)/ | 2022-02-10 21:04 | - | |
| Hytti nro 6 (Compartment Nº 6) (2021)/ | 2022-02-10 21:04 | - | |
| Das Privileg/ | 2022-02-10 23:39 | - | |
| Waterworld/ | 2022-02-11 01:32 | - | |
| La última pelea lat/ | 2022-02-11 01:49 | - | |
| Olympus Has Fallen (Objetivo La Casa Blanca) (2013)/ | 2022-02-11 03:26 | - | |
| Agente bajo fuego (2019)/ | 2022-02-11 03:26 | - | |
| Londres bajo fuego/ | 2022-02-11 03:26 | - | |
| ANNE+ LA PELÍCULA (2021)/ | 2022-02-12 03:36 | - | |
| TÁCTICAS DE AMOR (2022)/ | 2022-02-12 03:46 | - | |
| CÁSATE CONMIGO (2022)/ | 2022-02-12 03:47 | - | |
| EL CIELO ESTÁ EN CUALQUIER LUGAR (2022)/ | 2022-02-12 03:48 | - | |
| LA HISTORIA DE UNA SIRVIENTA (2020)/ | 2022-02-12 03:48 | - | |
| BIGBUG (2022)/ | 2022-02-12 03:54 | - | |
| QUIERO QUE VUELVAS (2022)/ | 2022-02-12 04:12 | - | |
| AMARRADOS AL AMOR (2022/ | 2022-02-12 04:12 | - | |
| Tall Girl 2 (A mi altura 2) (2022)/ | 2022-02-12 04:48 | - | |
| El Conjuro 3/ | 2022-02-12 06:16 | - | |
| The Tinder Swindler (El estafador de Tinder) (2022)/ | 2022-02-14 03:19 | - | |
| La La Land/ | 2022-02-14 04:14 | - | |
| El Rey Arturo/ | 2022-02-16 00:46 | - | |
| Independence Day (Día de la independencia) (1996)/ | 2022-02-16 00:46 | - | |
| El quinto elemento/ | 2022-02-16 00:46 | - | |
| Enemigo Publico/ | 2022-02-16 00:46 | - | |
| Con Air/ | 2022-02-16 01:00 | - | |
| THE ROCK/ | 2022-02-16 01:01 | - | |
| ARMAGEDDON/ | 2022-02-16 01:03 | - | |
| AIR FORCE ONE/ | 2022-02-16 01:04 | - | |
| The Hitman’s Bodyguard (Duro de cuidar) (2017)/ | 2022-02-16 04:24 | - | |
| Hamilton/ | 2022-02-17 04:20 | - | |
| Erax (C) (2022)/ | 2022-02-17 19:36 | - | |
| Heart Shot (S) (Disparo al corazón (C)) (2022)/ | 2022-02-17 19:36 | - | |
| Forgive Us Our Trespasses (S) (Perdona nuestras ofensas (C)) (2022)/ | 2022-02-17 19:36 | - | |
| Sundown (2021)/ | 2022-02-17 19:39 | - | |
| Scream (Grita) (2022)/ | 2022-02-17 19:40 | - | |
| Fistful of Vengeance (Venganza a golpes) (2022)/ | 2022-02-17 20:13 | - | |
| The Gateway (2021)/ | 2022-02-18 02:38 | - | |
| Infiltrado en el KKKlan/ | 2022-02-18 04:36 | - | |
| Gli uomini d’oro (2021)/ | 2022-02-21 07:02 | - | |
| Nordsjøen (North Sea) (2021)/ | 2022-02-21 07:02 | - | |
| Petite maman (2021)/ | 2022-02-21 07:02 | - | |
| Ride the Eagle (Vuela como el águila) (2021)/ | 2022-02-21 07:02 | - | |
| Romancing the Birthday Girl (2021)/ | 2022-02-21 07:02 | - | |
| Ted K (2021)/ | 2022-02-21 07:02 | - | |
| Last Survivors (2022)/ | 2022-02-21 07:17 | - | |
| Downfall The Case Against Boeing(2022)/ | 2022-02-21 07:18 | - | |
| Kalavryta 1943 (2021)/ | 2022-02-21 07:20 | - | |
| Red Sparrow/ | 2022-02-21 18:18 | - | |
| A Christmas Carol/ | 2022-02-21 20:20 | - | |
| El gran salto (2019)/ | 2022-02-21 20:54 | - | |
| False Positive (2021)/ | 2022-02-21 20:54 | - | |
| Leonardo The Works (2019)/ | 2022-02-21 20:54 | - | |
| Proekt ‘Gemini’ (2022)/ | 2022-02-21 20:54 | - | |
| Warcraft/ | 2022-02-22 21:55 | - | |
| Catch the Fair One (2021)/ | 2022-02-23 18:18 | - | |
| Off the Rails (El viaje de sus vidas) (2021)/ | 2022-02-23 18:18 | - | |
| Rum 213 (2017)/ | 2022-02-23 18:18 | - | |
| One Night Off (2021)/ | 2022-02-23 18:18 | - | |
| Pursuit (2022)/ | 2022-02-24 22:44 | - | |
| Blithe Spirit (2020)/ | 2022-02-26 19:03 | - | |
| Follow Me (2020)/ | 2022-02-26 19:03 | - | |
| Desperate Riders (2022)/ | 2022-02-26 19:03 | - | |
| A Madea Homecoming (El regreso a casa de Madea) (2022)/ | 2022-02-26 19:03 | - | |
| El ventre del mar (2021)/ | 2022-02-26 19:03 | - | |
| Hellbender (2021)/ | 2022-02-26 19:20 | - | |
| L intervention (2019)/ | 2022-02-26 19:22 | - | |
| Later Days (2021)/ | 2022-02-26 19:22 | - | |
| Miss Willoughby and the Haunted Bookshop (2021)/ | 2022-02-26 19:25 | - | |
| No Exit (Sin salida) (2022)/ | 2022-02-26 19:26 | - | |
| Sans répit (2022)/ | 2022-02-26 19:27 | - | |
| The Souvenir. Part II (2021)/ | 2022-02-26 19:38 | - | |
| The Beta Test (2021)/ | 2022-02-26 19:41 | - | |
| Dr. Bird’s Advice for Sad Poets (2020)/ | 2022-02-26 19:43 | - | |
| Le loup et le lion (El lobo y el león) (2021)/ | 2022-02-26 19:46 | - | |
| West Side Story (Amor sin barreras) (2021)/ | 2022-02-27 18:09 | - | |
| Alone with You (2021)/ | 2022-02-27 18:09 | - | |
| Shattered (2022)/ | 2022-02-27 18:09 | - | |
| Manyeo (The Witch Part 1The Subversion) (2018)/ | 2022-02-28 01:41 | - | |
| A Tale of Two Guns (2022)/ | 2022-02-28 22:28 | - | |
| All About Sex (Todo Sobre Sexo) (2021)/ | 2022-02-28 22:28 | - | |
| Indemnity (2021)/ | 2022-02-28 22:28 | - | |
| Our Ladies (Nuestras damas) (2019)/ | 2022-02-28 22:28 | - | |
| Arrhythmia (2017)/ | 2022-02-28 22:28 | - | |
| Das Ende der Wahrheit (Blame Game) (2019)/ | 2022-02-28 22:39 | - | |
| Moje wspaniale zycie (Mi maravillosa vida) (2021)/ | 2022-02-28 22:51 | - | |
| A House on the Bayou (2021)/ | 2022-02-28 22:52 | - | |
| Les Fantasmes (2021)/ | 2022-02-28 22:54 | - | |
| Fallen (2022)/ | 2022-02-28 22:55 | - | |
| Mothering Sunday (2021)/ | 2022-02-28 22:55 | - | |
| 11M (2022)/ | 2022-03-03 03:39 | - | |
| A Banquet (2021)/ | 2022-03-03 03:39 | - | |
| Contra (2020)/ | 2022-03-03 03:39 | - | |
| Doraibu mai kâ (Drive My Car) (2021)/ | 2022-03-03 03:39 | - | |
| La soga 2 (2021)/ | 2022-03-03 03:39 | - | |
| jesuisla (2019)/ | 2022-03-03 03:39 | - | |
| Curious George Cape Ahoy (2021)/ | 2022-03-03 03:39 | - | |
| Earthquake Legendary (2022)/ | 2022-03-03 03:39 | - | |
| Against the Ice (Dos contra el hielo) (2022)/ | 2022-03-03 03:48 | - | |
| Shepherd (2021)/ | 2022-03-03 03:54 | - | |
| Shut In (2022)/ | 2022-03-03 04:11 | - | |
| The Pirates The Last Royal Treasure (2022)/ | 2022-03-03 04:11 | - | |
| Surviving Paradise A Family Tale (El paraíso que sobrevive Un legado familiar) (2022)/ | 2022-03-04 04:46 | - | |
| Blacklight (Luz negra) (2022)/ | 2022-03-04 04:56 | - | |
| Zodiaco/ | 2022-03-04 17:14 | - | |
| Belle/ | 2022-03-04 19:34 | - | |
| Ni Idea/ | 2022-03-05 05:11 | - | |
| Walk of Fame/ | 2022-03-05 06:32 | - | |
| Breathe/ | 2022-03-05 06:32 | - | |
| La habitación/ | 2022-03-05 06:32 | - | |
| El sueño de Gabrielle/ | 2022-03-05 06:32 | - | |
| Lo más sencillo es complicarlo todo/ | 2022-03-05 06:32 | - | |
| SPF-18/ | 2022-03-05 06:32 | - | |
| Un hombre de altura/ | 2022-03-05 06:32 | - | |
| Home Again/ | 2022-03-05 06:39 | - | |
| Cómo perder a un chico en 10 días/ | 2022-03-05 06:51 | - | |
| La batalla de los sexos/ | 2022-03-05 06:53 | - | |
| Mike and Dave Need Wedding Dates/ | 2022-03-05 06:54 | - | |
| El juego de Gerald/ | 2022-03-05 06:58 | - | |
| Muži v naději/ | 2022-03-05 06:59 | - | |
| The Light Between Oceans/ | 2022-03-05 07:02 | - | |
| A la mala/ | 2022-03-05 07:04 | - | |
| Sufragistas/ | 2022-03-05 07:12 | - | |
| Maria Bamford/ | 2022-03-05 07:14 | - | |
| Juntos y revueltos/ | 2022-03-05 16:13 | - | |
| Eres mi pasión/ | 2022-03-06 03:36 | - | |
| De mentes maestras/ | 2022-03-06 03:36 | - | |
| El libro secreto de Henry/ | 2022-03-06 03:36 | - | |
| Planetarium/ | 2022-03-06 03:36 | - | |
| Corazón de león/ | 2022-03-06 03:36 | - | |
| Jane Got a Gun/ | 2022-03-06 03:36 | - | |
| El caso Fischer/ | 2022-03-06 03:36 | - | |
| La Boda de Valentina/ | 2022-03-06 03:36 | - | |
| El Joven Mesias/ | 2022-03-06 03:38 | - | |
| Estar o no estar/ | 2022-03-06 03:53 | - | |
| Bikini Model Academy/ | 2022-03-06 04:00 | - | |
| Hangman/ | 2022-03-06 04:00 | - | |
| 2067 (2020)/ | 2022-03-08 05:13 | - | |
| dulces sueños mama/ | 2022-03-08 05:13 | - | |
| After Love/ | 2022-03-08 05:35 | - | |
| Army of One/ | 2022-03-08 05:35 | - | |
| Poppie Nongena/ | 2022-03-08 05:35 | - | |
| Lucy and Desi/ | 2022-03-08 05:59 | - | |
| Hacksaw/ | 2022-03-08 06:03 | - | |
| The Hating Game/ | 2022-03-08 06:09 | - | |
| El hilo invisible/ | 2022-03-08 06:11 | - | |
| The Weekend Away/ | 2022-03-08 06:14 | - | |
| Boîte noire (2020)/ | 2022-03-08 17:56 | - | |
| Sin señas particulares (2020)/ | 2022-03-08 17:56 | - | |
| La civil/ | 2022-03-09 03:03 | - | |
| Titanic Into the Heart Of The Wreck (2020)/ | 2022-03-09 22:18 | - | |
| Természetes fény (Natural Light) (2021)/ | 2022-03-09 22:24 | - | |
| Goyo En letra de otro (2022)/ | 2022-03-09 22:26 | - | |
| SCHOOL DANCE/ | 2022-03-10 03:47 | - | |
| Blacklight/ | 2022-03-11 01:04 | - | |
| Pil (2021)/ | 2022-03-11 02:16 | - | |
| The Adam Project/ | 2022-03-11 18:52 | - | |
| Polaroid/ | 2022-03-13 17:56 | - | |
| chr0n1cl3s 0f th3 g0stly 2015 webs subesp gnula/ | 2022-03-14 03:23 | - | |
| Mi villano favorito/ | 2022-03-16 03:31 | - | |
| Marilyn ha gli occhi neri (Marilyn tiene los ojos negros) (2021)/ | 2022-03-17 03:02 | - | |
| The Desperate Hour (2021)/ | 2022-03-17 03:02 | - | |
| À l’abordage! (¡Al abordaje!) (2020)/ | 2022-03-17 03:02 | - | |
| Adam by Eve A Live in Animation (Adam by Eve Un concierto animado) (2022)/ | 2022-03-17 03:02 | - | |
| The Bunker Game (2022)/ | 2022-03-17 03:02 | - | |
| The Pebble and the Boy/ | 2022-03-17 03:02 | - | |
| The Velvet Underground (2021)/ | 2022-03-17 03:02 | - | |
| Small Engine Repair (2021)/ | 2022-03-17 03:02 | - | |
| Change in the Air (Vientos de cambio) (2018)/ | 2022-03-17 03:16 | - | |
| El último tren al rock’n’roll (2021)/ | 2022-03-17 03:23 | - | |
| Margrete den forste (2021)/ | 2022-03-17 03:23 | - | |
| Finding You (2021)/ | 2022-03-17 03:25 | - | |
| Assault on VA-33 (2021)/ | 2022-03-17 03:26 | - | |
| Pan de limón con semillas de amapola (2021)/ | 2022-03-17 03:28 | - | |
| Crow Valley (2021)/ | 2022-03-17 03:28 | - | |
| Bruce Springsteen’s Letter to You (2020)/ | 2022-03-17 03:28 | - | |
| Jukai Mura (2021)/ | 2022-03-17 03:30 | - | |
| Monica and Friends/ | 2022-03-17 03:36 | - | |
| Offseason (2021)/ | 2022-03-17 03:42 | - | |
| Rescued by Ruby/ | 2022-03-18 02:01 | - | |
| Aguas profundas/ | 2022-03-18 19:21 | - | |
| Black Crab/ | 2022-03-18 19:21 | - | |
| Hasta que nos volvamos a encontrar/ | 2022-03-18 19:21 | - | |
| Master/ | 2022-03-18 19:21 | - | |
| Windfall/ | 2022-03-18 19:21 | - | |
| Chacun chez soi/ | 2022-03-19 05:16 | - | |
| Ecos de un crimen/ | 2022-03-19 05:16 | - | |
| Cheaper by the Dozen/ | 2022-03-20 16:16 | - | |
| S.O.S. Mamis/ | 2022-03-20 16:16 | - | |
| La Mansión Wolfberg/ | 2022-03-20 16:16 | - | |
| La Abuela/ | 2022-03-20 16:16 | - | |
| Jawbreaker/ | 2022-03-20 17:03 | - | |
| Fast and Fierce Death Race/ | 2022-03-21 03:59 | - | |
| Skyggen i mit øje/ | 2022-03-21 04:07 | - | |
| Suicide Forest Village/ | 2022-03-21 04:11 | - | |
| The Colony/ | 2022-03-22 05:06 | - | |
| JACKASS POR SIEMPRE (2022)/ | 2022-03-23 03:52 | - | |
| Sex Appeal/ | 2022-03-23 03:52 | - | |
| UN LUGAR SEGURO (2022)/ | 2022-03-23 03:52 | - | |
| Las mejores familias (2020)/ | 2022-03-24 05:58 | - | |
| Pasajero 666/ | 2022-03-26 07:03 | - | |
| Competencia Oficial/ | 2022-03-26 07:03 | - | |
| Cosas imposibles/ | 2022-03-26 07:03 | - | |
| Rzhev (2019)/ | 2022-03-26 07:13 | - | |
| The Kid/ | 2022-03-28 17:05 | - | |
| La hija (2021)/ | 2022-03-28 17:38 | - | |
| Retfærdighedens ryttere/ | 2022-03-28 17:38 | - | |
| Un Rabón Con Corazón/ | 2022-03-28 17:38 | - | |
| Paper Spiders (Arañas de papel) (2020)/ | 2022-03-28 17:38 | - | |
| Efímera como la flor del cerezo/ | 2022-03-28 17:38 | - | |
| Resguardado (2019)/ | 2022-03-28 17:38 | - | |
| The Assistant (2021)/ | 2022-03-28 17:38 | - | |
| A Professor’s Vengeance (2021)/ | 2022-03-28 17:57 | - | |
| Más que robots/ | 2022-03-28 17:58 | - | |
| Revelator/ | 2022-03-28 18:02 | - | |
| Songbird (2020)/ | 2022-03-28 18:03 | - | |
| Death on the Nile (Muerte en el Nilo) (2022)/ | 2022-03-29 01:07 | - | |
| ATTACK ON TITAN ALAS DE LA LIBERTAD (2015)/ | 2022-03-29 15:43 | - | |
| ATTACK ON TITAN EL ARCO Y FLECHA ESCARLATA (2014)/ | 2022-03-29 15:43 | - | |
| ATTACK ON TITAN EL RUGIDO DEL DESPERTAR (2018)/ | 2022-03-29 15:43 | - | |
| El limpiaparabrisas/ | 2022-03-29 15:57 | - | |
| Criadas y señoras/ | 2022-03-30 05:19 | - | |
| ANIMALES FANTÁSTICOS UNA HISTORIA NATURAL (2022)/ | 2022-04-03 01:47 | - | |
| CABALGANDO A LA GLORIA (2020)/ | 2022-04-03 01:47 | - | |
| GRANIZO (2022) 1080P/ | 2022-04-03 01:47 | - | |
| TERRITORIO (2019) 1080P/ | 2022-04-03 02:16 | - | |
| The Bubble/ | 2022-04-03 02:23 | - | |
| SUEÑOS DE MARTE (2022)/ | 2022-04-03 05:07 | - | |
| CAPITANA NOVA (2021)/ | 2022-04-03 05:13 | - | |
| SIEMPRE EN EL MEJOR MOMENTO (2021)/ | 2022-04-03 05:15 | - | |
| NATE MEJOR TARDE QUE NUNCA (2022)/ | 2022-04-03 05:18 | - | |
| NO CONFÍES EN NADIE TRAS LA PISTA DEL REY DE LAS CRIPTOMONEDAS/ | 2022-04-03 05:23 | - | |
| APOLO10UNA INFANCIA ESPACIAL2022)/ | 2022-04-03 05:28 | - | |
| EN BUSCA DE FÍGARO (2020)/ | 2022-04-03 05:30 | - | |
| Out of Death/ | 2022-04-03 17:17 | - | |
| Apex (2021)/ | 2022-04-03 17:58 | - | |
| Deadlock/ | 2022-04-03 17:58 | - | |
| El Closet (2020)/ | 2022-04-03 17:58 | - | |
| Fortress/ | 2022-04-03 17:58 | - | |
| American Siege/ | 2022-04-03 17:58 | - | |
| Predestination/ | 2022-04-04 21:51 | - | |
| Cuestión de Tiempo/ | 2022-04-04 21:51 | - | |
| The Shack/ | 2022-04-04 22:08 | - | |
| Me contro Te La venganza del señor S. (2020) HD 1080p/ | 2022-04-05 00:00 | - | |
| Pasión, amor y muerte (2021) HD 1080p/ | 2022-04-05 00:00 | - | |
| Swipe Right, Run Left/ | 2022-04-05 00:37 | - | |
| El Rezador2021/ | 2022-04-05 16:30 | - | |
| Más allá de ti (2020) HD 1080p/ | 2022-04-05 16:30 | - | |
| Pequeña mamá (2021/ | 2022-04-05 16:30 | - | |
| Alice/ | 2022-04-06 18:13 | - | |
| As Luck Would Have It/ | 2022-04-06 19:04 | - | |
| The Wrong Cheer Captain/ | 2022-04-06 19:04 | - | |
| Furioza/ | 2022-04-06 19:04 | - | |
| Espíritu Sagrado/ | 2022-04-06 19:04 | - | |
| MADRASTRA PELIGROSA (2021)/ | 2022-04-06 19:04 | - | |
| The Beatles y la India/ | 2022-04-06 19:04 | - | |
| The Contractor/ | 2022-04-07 04:48 | - | |
| Mainstream/ | 2022-04-07 05:16 | - | |
| Pompo, la magia del cine/ | 2022-04-07 05:38 | - | |
| Over the Sky/ | 2022-04-07 05:41 | - | |
| Barbarians/ | 2022-04-07 05:44 | - | |
| Fuel/ | 2022-04-07 05:45 | - | |
| Madelines/ | 2022-04-07 05:47 | - | |
| You Are Not My Mother/ | 2022-04-07 05:49 | - | |
| We Are Boats/ | 2022-04-07 05:51 | - | |
| Batalla Freestyle/ | 2022-04-07 05:54 | - | |
| Bookworm and the Beast/ | 2022-04-07 05:56 | - | |
| Love Lost Y Found/ | 2022-04-07 05:58 | - | |
| Lights Camera Romance/ | 2022-04-07 06:00 | - | |
| Tony Hawk Hasta que las ruedas aguanten (2022)/ | 2022-04-08 04:44 | - | |
| La Llamada del Diablo (2020) HD 1080p/ | 2022-04-08 04:44 | - | |
| The Outfit/ | 2022-04-08 04:44 | - | |
| All the Old Knives/ | 2022-04-08 05:59 | - | |
| Return to Space/ | 2022-04-08 05:59 | - | |
| El rey de la fiesta/ | 2022-04-08 18:22 | - | |
| Yaksha Ruthless Operations/ | 2022-04-08 18:22 | - | |
| Entre la vida y la muerte (2022) HD 1080p/ | 2022-04-08 18:22 | - | |
| Las niñas de cristal/ | 2022-04-08 18:22 | - | |
| La Pasión de Cristo (2004)/ | 2022-04-12 18:28 | - | |
| El amor en su lugar/ | 2022-04-12 21:53 | - | |
| Bulldozer/ | 2022-04-12 23:22 | - | |
| Burn/ | 2022-04-12 23:22 | - | |
| Cato/ | 2022-04-12 23:25 | - | |
| Infinite Storm/ | 2022-04-12 23:26 | - | |
| Laura Pausini/ | 2022-04-12 23:27 | - | |
| Sin Eater/ | 2022-04-12 23:29 | - | |
| The Nameless Days/ | 2022-04-12 23:30 | - | |
| Umma/ | 2022-04-12 23:31 | - | |
| Metal Lords/ | 2022-04-12 23:48 | - | |
| QuE les pasa a los hombres/ | 2022-04-13 00:46 | - | |
| invictus/ | 2022-04-13 00:46 | - | |
| Final Fantasy VII/ | 2022-04-13 02:06 | - | |
| Final Fantasy VII Last Order/ | 2022-04-13 02:06 | - | |
| Final Fantasy XV/ | 2022-04-13 02:06 | - | |
| Gold/ | 2022-04-13 15:16 | - | |
| Every Last Secret/ | 2022-04-13 15:16 | - | |
| Poskromienie zlosnicy/ | 2022-04-13 15:16 | - | |
| Amalgama.2022.1080p/ | 2022-04-13 18:02 | - | |
| Puños de Sangre (2020)/ | 2022-04-15 07:13 | - | |
| Todos Para Uma (2021) HD 1080p/ | 2022-04-16 03:08 | - | |
| It’s the Small Things, Charlie Brown/ | 2022-04-16 06:51 | - | |
| Elige o muere (2022) HD 1080p/ | 2022-04-17 16:16 | - | |
| El Príncipe de Egipto/ | 2022-04-17 16:16 | - | |
| Hombre de Dios/ | 2022-04-17 16:16 | - | |
| Mogadishu (2020)/ | 2022-04-17 16:16 | - | |
| La aldea de los suicidios (2021)/ | 2022-04-18 00:21 | - | |
| Marcelino pan y vino/ | 2022-04-18 01:26 | - | |
| Jovenes Titanes en Accion vs Jovenes Titanes/ | 2022-04-18 04:42 | - | |
| The Batman/ | 2022-04-18 16:35 | - | |
| Chariot/ | 2022-04-18 19:47 | - | |
| Electric Jesus/ | 2022-04-18 19:47 | - | |
| Better Days/ | 2022-04-22 06:02 | - | |
| Escape Through Africa/ | 2022-04-22 17:59 | - | |
| Raging Fire/ | 2022-04-22 17:59 | - | |
| Chain Reaction/ | 2022-04-22 17:59 | - | |
| Farruko En letra de otro/ | 2022-04-22 17:59 | - | |
| Kany García Soy Yo en Vivo/ | 2022-04-22 17:59 | - | |
| De Lo Mio/ | 2022-04-22 17:59 | - | |
| Arctic Void/ | 2022-04-22 17:59 | - | |
| Uncharted Fuera del Mapa (2022)/ | 2022-04-23 05:04 | - | |
| Dead Man s SwitchA Crypto Mystery/ | 2022-04-23 17:28 | - | |
| Ambulance/ | 2022-04-23 17:28 | - | |
| Cobalt Blue/ | 2022-04-23 17:28 | - | |
| El largo viaje de Alejandro Bordón/ | 2022-04-23 17:28 | - | |
| Eso que tú me das/ | 2022-04-23 17:28 | - | |
| Punto de inflexión/ | 2022-04-23 17:28 | - | |
| Osa polar (2022)/ | 2022-04-23 18:25 | - | |
| THAI-DRAGON/ | 2022-04-23 18:25 | - | |
| Virus 32 (2022)/ | 2022-04-23 18:25 | - | |
| Fourth Grade/ | 2022-04-23 18:25 | - | |
| Cr4zy B34ut1ful 2001DVDRv0s3/ | 2022-04-23 19:34 | - | |
| Johnny Bravo Goes to Bollywood/ | 2022-04-23 23:15 | - | |
| Toy Aficiao/ | 2022-04-23 23:15 | - | |
| CrO em Família/ | 2022-04-23 23:15 | - | |
| The Blackout Experiment/ | 2022-04-23 23:15 | - | |
| Doll Cemetery/ | 2022-04-27 18:06 | - | |
| End Trip/ | 2022-04-27 18:06 | - | |
| Furie/ | 2022-04-27 18:06 | - | |
| Intervention/ | 2022-04-27 18:06 | - | |
| Panteras Viviendo entre felinos/ | 2022-04-27 18:06 | - | |
| To Be Someone/ | 2022-04-27 18:06 | - | |
| Brut Force/ | 2022-04-27 18:06 | - | |
| Gaspar/ | 2022-04-27 18:06 | - | |
| A Cowgirl s Song/ | 2022-04-27 18:22 | - | |
| 365 dias Aquel día/ | 2022-04-29 05:28 | - | |
| The Biggest Little Farm The Return/ | 2022-04-29 05:28 | - | |
| Children of Sin/ | 2022-04-29 05:47 | - | |
| Explorer The Last Tepui/ | 2022-04-29 05:47 | - | |
| I LOVE AMERICA (2022)/ | 2022-04-29 21:26 | - | |
| RUMSPRINGA (2022)/ | 2022-04-29 21:26 | - | |
| LA OCTAVA CLÁUSULA (2022)/ | 2022-04-29 21:26 | - | |
| NO SOY UN ASESINO (2019)/ | 2022-04-29 21:26 | - | |
| UNA ISLA IRRITANTE (2019)/ | 2022-04-29 21:26 | - | |
| EL GOLPE (2019)/ | 2022-04-29 21:32 | - | |
| CRUSH (2022)/ | 2022-04-29 21:32 | - | |
| AMOR DE MADRE (2022)/ | 2022-04-29 21:33 | - | |
| 14 DÍAS 12 NOCHES (2019)/ | 2022-04-29 21:33 | - | |
| ¡QUÉ DESPADRE! (2022)/ | 2022-04-30 04:41 | - | |
| Fuerte El Ojo Del Francotirador (2022)/ | 2022-04-30 04:41 | - | |
| Melancolia/ | 2022-05-03 04:36 | - | |
| AQUAMAN/ | 2022-05-03 05:16 | - | |
| Fantástico Sr. Zorro LAT/ | 2022-05-03 05:16 | - | |
| Redeeming Love/ | 2022-05-03 15:29 | - | |
| Sonic 2/ | 2022-05-04 23:25 | - | |
| Hard Luck Love Song (2021)/ | 2022-05-05 04:11 | - | |
| Jockey (2021)/ | 2022-05-05 04:11 | - | |
| El último ritual/ | 2022-05-05 04:11 | - | |
| Cuarentones (2022)/ | 2022-05-05 04:11 | - | |
| ¿Nos casamos Sí, mi amor (2022)/ | 2022-05-05 04:11 | - | |
| Soccer Mom Madam/ | 2022-05-05 05:42 | - | |
| Aguanta la respiración Inmersión bajo el hielo/ | 2022-05-05 05:47 | - | |
| Cuatro horas en el Capitolio/ | 2022-05-05 05:49 | - | |
| La estrella roja/ | 2022-05-05 05:52 | - | |
| En la mira/ | 2022-05-05 05:54 | - | |
| Las ilusiones perdidas/ | 2022-05-05 05:57 | - | |
| Tarsilinha/ | 2022-05-07 03:57 | - | |
| Matky (2021)/ | 2022-05-07 03:57 | - | |
| Scarborough/ | 2022-05-07 03:57 | - | |
| Thar/ | 2022-05-07 03:57 | - | |
| Windstorm The Great Hurricane/ | 2022-05-07 03:57 | - | |
| Pride Jewel/ | 2022-05-07 03:57 | - | |
| Marmaduke (2022/ | 2022-05-07 04:16 | - | |
| Honest Candidate/ | 2022-05-07 04:16 | - | |
| Arcadeología/ | 2022-05-07 04:17 | - | |
| DIGIMON ADVENTURE LA ÚLTIMA EVOLUCIÓN KIZUNA (2020)/ | 2022-05-07 05:01 | - | |
| Canelo Alvarez vs. Dmitry Bivol/ | 2022-05-08 16:15 | - | |
| Step Up. Bailando/ | 2022-05-10 03:28 | - | |
| Step Up China/ | 2022-05-10 03:58 | - | |
| Wrestlemania Backlash/ | 2022-05-10 04:32 | - | |
| Night of the Sicario/ | 2022-05-10 05:32 | - | |
| GHOST IN THE SHELL SAC_2045 GUERRA SOSTENIBLE/ | 2022-05-10 05:32 | - | |
| Loin du périph (Incompatibles 2)/ | 2022-05-10 05:35 | - | |
| Set It Up El plan imperfecto (2018)/ | 2022-05-10 05:35 | - | |
| DC Showcase Kamandi The Last Boy on Earth!/ | 2022-05-10 05:35 | - | |
| Death Valley/ | 2022-05-10 14:45 | - | |
| Corrective Measures/ | 2022-05-10 14:56 | - | |
| The Banishing/ | 2022-05-12 00:18 | - | |
| Stigmata (1999)/ | 2022-05-12 00:19 | - | |
| Operation Mincemeat/ | 2022-05-12 23:41 | - | |
| Original Gangster/ | 2022-05-12 23:41 | - | |
| The Accursed/ | 2022-05-12 23:41 | - | |
| The Exorcism of God/ | 2022-05-12 23:41 | - | |
| The Northman/ | 2022-05-12 23:41 | - | |
| Les Fantasmes/ | 2022-05-12 23:55 | - | |
| La familia perfecta/ | 2022-05-12 23:58 | - | |
| El maestro de las fugas/ | 2022-05-13 00:10 | - | |
| A Fairy Tale After All/ | 2022-05-13 00:11 | - | |
| Fantastic Beasts The Secrets of Dumbledore/ | 2022-05-13 01:33 | - | |
| Spree/ | 2022-05-13 01:33 | - | |
| Separation/ | 2022-05-13 18:50 | - | |
| Two Deaths of Henry Baker/ | 2022-05-13 18:50 | - | |
| Hidden Figures/ | 2022-05-14 15:30 | - | |
| Sneakerella/ | 2022-05-15 22:45 | - | |
| Senior Year/ | 2022-05-15 22:45 | - | |
| Firestarter/ | 2022-05-15 22:46 | - | |
| Burbuja/ | 2022-05-15 22:46 | - | |
| El Protector Renace (2022)/ | 2022-05-15 22:46 | - | |
| Our Father/ | 2022-05-16 04:30 | - | |
| Psych 3 This Is Gus/ | 2022-05-16 04:30 | - | |
| OtherLife/ | 2022-05-16 04:30 | - | |
| Shark Bait/ | 2022-05-16 04:30 | - | |
| Monstrous/ | 2022-05-16 04:30 | - | |
| Un amor intranquilo/ | 2022-05-16 04:30 | - | |
| Lillith/ | 2022-05-16 04:30 | - | |
| Fátima, la película/ | 2022-05-16 04:45 | - | |
| Frente al tornado/ | 2022-05-16 04:45 | - | |
| Dirty Work/ | 2022-05-16 04:49 | - | |
| Culpa/ | 2022-05-16 04:51 | - | |
| Atrapados en la oscuridad/ | 2022-05-16 05:21 | - | |
| Morbius/ | 2022-05-16 18:10 | - | |
| terminator salvation/ | 2022-05-16 23:18 | - | |
| Dog/ | 2022-05-18 04:07 | - | |
| Ola de calor (2022/ | 2022-05-19 14:23 | - | |
| Vicky Cristina Barcelona/ | 2022-05-19 18:16 | - | |
| Dangerous/ | 2022-05-19 19:13 | - | |
| Never Back Down Revolt/ | 2022-05-19 19:13 | - | |
| Memory/ | 2022-05-19 23:47 | - | |
| Ciberinfierno/ | 2022-05-19 23:48 | - | |
| The East/ | 2022-05-19 23:48 | - | |
| Hollow/ | 2022-05-19 23:48 | - | |
| A Paris Education/ | 2022-05-19 23:48 | - | |
| En la Toscana/ | 2022-05-19 23:48 | - | |
| Everything Went Fine) (2021)/ | 2022-05-19 23:48 | - | |
| Fck love/ | 2022-05-20 18:43 | - | |
| Trainspotting/ | 2022-05-21 19:32 | - | |
| El Valet/ | 2022-05-23 17:53 | - | |
| Jersey/ | 2022-05-23 17:56 | - | |
| KING REGRESO A CASA (2022)/ | 2022-05-23 17:57 | - | |
| A Perfect Pairing/ | 2022-05-23 17:59 | - | |
| Bull/ | 2022-05-23 18:04 | - | |
| CHIP Y DALE AL RESCATE (2022)/ | 2022-05-23 18:25 | - | |
| jackss.4.5/ | 2022-05-23 18:28 | - | |
| Along for the Ride/ | 2022-05-23 18:34 | - | |
| Snoopy Presents To Mom (and Dad), With Love/ | 2022-05-23 18:36 | - | |
| Hold Your Breath The Ice Dive/ | 2022-05-23 18:38 | - | |
| Teen Titans Go DC Super Hero Girls Mayhem in the Multiverse/ | 2022-05-24 04:21 | - | |
| El show de Truman/ | 2022-05-24 21:46 | - | |
| Nuevo Orden/ | 2022-05-25 04:56 | - | |
| Annapolis/ | 2022-05-25 05:35 | - | |
| Contra reloj/ | 2022-05-25 05:35 | - | |
| Identidad tomada (2020)/ | 2022-05-25 05:51 | - | |
| Godspeed (Que tengas buen viaje) (2022)/ | 2022-05-25 05:51 | - | |
| La Chica del Lago (2021)/ | 2022-05-25 05:51 | - | |
| Otra forma de entender la vida (2021)/ | 2022-05-25 05:51 | - | |
| El fotógrafo y el cartero El crimen de Cabezas (2022)/ | 2022-05-25 05:51 | - | |
| Break Every Chain (2021)/ | 2022-05-25 05:51 | - | |
| The Adventures of Maid Marian (2022)/ | 2022-05-25 05:51 | - | |
| Top Gun pasión y gloria/ | 2022-05-25 23:57 | - | |
| Fantastic Beasts 3/ | 2022-05-30 20:51 | - | |
| Dark Cloud/ | 2022-05-31 01:10 | - | |
| Dos más dos/ | 2022-05-31 03:15 | - | |
| Le Quai de Ouistreham (2021)/ | 2022-05-31 03:33 | - | |
| Dead by Midnight (2022)/ | 2022-05-31 03:33 | - | |
| Larva Pendant (El colgante de Isla Larva) (2022)/ | 2022-05-31 03:33 | - | |
| El último zombi (2020)/ | 2022-05-31 03:33 | - | |
| The Pact (2021)/ | 2022-05-31 03:33 | - | |
| Ariaferma (2021)/ | 2022-05-31 03:33 | - | |
| Carver (2021)/ | 2022-05-31 03:33 | - | |
| C mon C mon/ | 2022-05-31 23:07 | - | |
| Dark Glasses/ | 2022-05-31 23:10 | - | |
| Herederas/ | 2022-05-31 23:12 | - | |
| Waking Up To Danger/ | 2022-05-31 23:18 | - | |
| La Piel del Volcán/ | 2022-05-31 23:23 | - | |
| Swim Instructor Nightmare/ | 2022-06-03 23:14 | - | |
| South Park The Streaming Wars/ | 2022-06-04 02:55 | - | |
| Interceptor/ | 2022-06-04 02:58 | - | |
| Thirteen/ | 2022-06-04 03:10 | - | |
| Kids/ | 2022-06-04 03:13 | - | |
| Hollywood Stargirl/ | 2022-06-04 17:13 | - | |
| Fire Island/ | 2022-06-04 17:15 | - | |
| Father Stu/ | 2022-06-04 17:42 | - | |
| Fresh/ | 2022-06-04 17:43 | - | |
| Si ti no puedo/ | 2022-06-04 17:44 | - | |
| Palm springs/ | 2022-06-04 17:49 | - | |
| A Werewolf in England/ | 2022-06-04 18:19 | - | |
| Cleveland Abduction/ | 2022-06-04 18:19 | - | |
| Amundsen/ | 2022-06-04 18:19 | - | |
| Deadware/ | 2022-06-04 18:19 | - | |
| Double Threat/ | 2022-06-04 18:19 | - | |
| Corte de Amor/ | 2022-06-04 18:20 | - | |
| La ley del embudo/ | 2022-06-04 18:31 | - | |
| Mosquito/ | 2022-06-04 18:37 | - | |
| Navalny/ | 2022-06-04 18:40 | - | |
| Sin ti no puedo/ | 2022-06-04 18:41 | - | |
| The Overnight/ | 2022-06-04 18:42 | - | |
| The Reckoning/ | 2022-06-04 18:45 | - | |
| Tromperie/ | 2022-06-04 18:46 | - | |
| Unhuman/ | 2022-06-04 18:48 | - | |
| Wolf Hound/ | 2022-06-04 18:51 | - | |
| The Lost City/ | 2022-06-04 23:00 | - | |
| The Unbearable Weight of Massive Talent/ | 2022-06-06 19:29 | - | |
| Foxhole (2021)/ | 2022-06-06 23:22 | - | |
| Schachnovelle (The Royal Game) (2021)/ | 2022-06-06 23:26 | - | |
| El perfecto David (2021)/ | 2022-06-06 23:31 | - | |
| EL LIBRO DEL AMOR/ | 2022-06-08 19:12 | - | |
| Switched before birth/ | 2022-06-08 19:12 | - | |
| La pasajera/ | 2022-06-08 23:01 | - | |
| Made in Chinatown/ | 2022-06-08 23:01 | - | |
| No Man of God/ | 2022-06-08 23:01 | - | |
| Hustle/ | 2022-06-09 17:29 | - | |
| El juego de las llaves/ | 2022-06-09 17:34 | - | |
| Encuentros al Azar (2019)/ | 2022-06-09 20:52 | - | |
| Romance on the Menu/ | 2022-06-09 20:52 | - | |
| They Talk (2021)/ | 2022-06-10 00:57 | - | |
| Downton Abbey A New Era/ | 2022-06-10 00:57 | - | |
| Beyond Infinity Buzz and the Journey to Lightyear/ | 2022-06-10 17:39 | - | |
| Deserto Particular/ | 2022-06-10 17:39 | - | |
| HaRafsoda/ | 2022-06-10 17:39 | - | |
| Los Pacientes Recurrentes/ | 2022-06-10 17:39 | - | |
| Trees of Peace/ | 2022-06-10 17:39 | - | |
| hickenhare and the Hamster of Darkness/ | 2022-06-10 17:39 | - | |
| El paseo 6/ | 2022-06-12 06:37 | - | |
| Animales Fantastico 1080/ | 2022-06-16 03:06 | - | |
| La ira de dios 1080/ | 2022-06-16 03:06 | - | |
| Exodo La ultima marea 1080/ | 2022-06-16 03:06 | - | |
| Alpha 1080/ | 2022-06-16 03:06 | - | |
| Defile de corazones 1080/ | 2022-06-16 03:06 | - | |
| The Simpsons Movie (2007)/ | 2022-06-16 04:35 | - | |
| El padre de la novia/ | 2022-06-17 02:41 | - | |
| Dog Un Viaje Salvaje/ | 2022-06-17 02:41 | - | |
| Collision/ | 2022-06-17 02:41 | - | |
| El buda 2 camino a la iluminacion/ | 2022-06-17 05:19 | - | |
| The Island of Dr. Moreau (La isla del Dr. Moreau) (1996)/ | 2022-06-18 04:24 | - | |
| Spiderhead/ | 2022-06-18 18:13 | - | |
| Selena/ | 2022-06-19 17:32 | - | |
| Cha Cha Real Smooth A bailar/ | 2022-06-19 17:33 | - | |
| La fórmula ganadora de Jerry y Marge/ | 2022-06-19 17:33 | - | |
| Mariya El Símbolo de La Guerra/ | 2022-06-19 17:33 | - | |
| Centauro/ | 2022-06-20 15:52 | - | |
| Los Tigres del Norte Historias que contar/ | 2022-06-20 15:52 | - | |
| Jennifer Lopez Halftime/ | 2022-06-20 15:52 | - | |
| Broken Swords The Last In Line/ | 2022-06-20 15:52 | - | |
| Moon Crash/ | 2022-06-20 15:52 | - | |
| Finde/ | 2022-06-20 15:52 | - | |
| Iron Cross The Road to Normandy/ | 2022-06-20 15:52 | - | |
| Ip Man El Despertar/ | 2022-06-20 15:52 | - | |
| Nudo Mixteco/ | 2022-06-20 16:06 | - | |
| Swap Me Baby/ | 2022-06-20 16:08 | - | |
| The Good Neighbor/ | 2022-06-20 16:09 | - | |
| The Lost Girls/ | 2022-06-20 16:09 | - | |
| The Martha Mitchell Effect/ | 2022-06-20 16:11 | - | |
| Doctor.Strange2022.WEB-DL.60FPS.1080p.Latino/ | 2022-06-22 00:36 | - | |
| X 2022/ | 2022-06-23 04:04 | - | |
| The Day the Earth Stood Still/ | 2022-06-23 04:37 | - | |
| North.Hollywood.2021/ | 2022-06-24 00:02 | - | |
| Gracia y coraje (2021)/ | 2022-06-24 00:02 | - | |
| Guardianes del Tiempo (2019)/ | 2022-06-24 00:02 | - | |
| Condena de amor (2022)/ | 2022-06-24 18:10 | - | |
| Watcher/ | 2022-06-24 18:10 | - | |
| Un triomphe/ | 2022-06-24 18:10 | - | |
| La vida era eso/ | 2022-06-24 18:25 | - | |
| La Vida en el Silencio/ | 2022-06-24 18:26 | - | |
| La croisade/ | 2022-06-24 18:26 | - | |
| Great Freedom/ | 2022-06-24 18:34 | - | |
| First Love/ | 2022-06-24 18:37 | - | |
| El hombre ciego que no quería ver Titanic/ | 2022-06-24 18:39 | - | |
| Directamente para video/ | 2022-06-24 18:39 | - | |
| Civil Ben Crump (2022)/ | 2022-06-24 18:43 | - | |
| Centigrade/ | 2022-06-24 18:48 | - | |
| The Girl from the Other Side/ | 2022-06-24 19:01 | - | |
| Run/ | 2022-06-24 19:10 | - | |
| Alien, el octavo pasajero (1979)/ | 2022-06-24 19:19 | - | |
| Hidden Terror en Kingsville (2015)/ | 2022-06-24 19:25 | - | |
| Outlander/ | 2022-06-24 19:50 | - | |
| Mi Villano Favorito/ | 2022-06-26 21:10 | - | |
| Minions (2015)/ | 2022-06-26 23:10 | - | |
| Risky Business/ | 2022-06-27 00:26 | - | |
| Cocktail (1988)/ | 2022-06-27 01:18 | - | |
| The Color of Money (El color del dinero) (1986)/ | 2022-06-27 01:18 | - | |
| rain man/ | 2022-06-27 01:18 | - | |
| Legend 1985/ | 2022-06-27 05:12 | - | |
| Days of Thunder/ | 2022-06-27 06:09 | - | |
| The Firm FACHADA/ | 2022-06-27 06:09 | - | |
| Nacido el 4 d julio/ | 2022-06-27 06:09 | - | |
| Far and Away (Un horizonte lejano) (1992)/ | 2022-06-27 06:09 | - | |
| Cuestión de honor/ | 2022-06-27 06:39 | - | |
| Eyes wide shut/ | 2022-06-27 18:16 | - | |
| Guerra de Mundos/ | 2022-06-27 18:16 | - | |
| Entrevista con el vampiro/ | 2022-06-27 18:16 | - | |
| Jerry Maguire/ | 2022-06-27 18:16 | - | |
| el ultimo samurai/ | 2022-06-27 18:16 | - | |
| Vanilla Sky (2001)/ | 2022-06-27 18:23 | - | |
| Jack Reacher/ | 2022-06-28 06:37 | - | |
| Collateral/ | 2022-06-28 06:37 | - | |
| Knight and Day/ | 2022-06-28 06:51 | - | |
| La era del rock/ | 2022-06-28 06:55 | - | |
| Lions for Lambs/ | 2022-06-28 06:59 | - | |
| Magnolia/ | 2022-06-28 07:06 | - | |
| Minority Report/ | 2022-06-28 07:08 | - | |
| Valkyrie/ | 2022-06-28 07:09 | - | |
| Mision imposible/ | 2022-06-29 14:41 | - | |
| Madre hasta la muerte (2020/ | 2022-06-29 19:47 | - | |
| La Médium (2021)/ | 2022-06-29 19:47 | - | |
| El ex novio equivocado/ | 2022-06-29 19:47 | - | |
| Misterio en Marbella (2022)/ | 2022-07-01 07:19 | - | |
| Unabomber Terrorista (2021)/ | 2022-07-01 07:19 | - | |
| Los Nuevos Vengadores (2018)/ | 2022-07-01 07:19 | - | |
| Y como es el (2020)/ | 2022-07-01 07:19 | - | |
| Amigos vs. extraterrestres (2022)/ | 2022-07-01 16:01 | - | |
| Tigres salvajes de Rusia (2022/ | 2022-07-01 16:12 | - | |
| 7th y Union (2021)/ | 2022-07-01 16:17 | - | |
| Rise (2022)/ | 2022-07-01 16:20 | - | |
| Anti Life/ | 2022-07-01 16:24 | - | |
| El Hombre De Toronto (2022/ | 2022-07-01 16:25 | - | |
| Amor y gelato (2022)/ | 2022-07-01 16:29 | - | |
| D Artagnan El 4º Mosquetero/ | 2022-07-01 16:31 | - | |
| A Olivia/ | 2022-07-01 16:35 | - | |
| The Dissident/ | 2022-07-01 16:38 | - | |
| Post Mortem - Fotos del Más Allá (2020)/ | 2022-07-01 16:40 | - | |
| Mi Novio Falso (2022)/ | 2022-07-01 16:42 | - | |
| Glamour Girls/ | 2022-07-01 16:45 | - | |
| jours sans maman/ | 2022-07-01 16:54 | - | |
| 9 Bullets/ | 2022-07-01 17:58 | - | |
| True Things/ | 2022-07-01 17:59 | - | |
| Disappearance in Yellowstone (2022)/ | 2022-07-01 17:59 | - | |
| Beasts That Cling to the Straw (2020)/ | 2022-07-01 17:59 | - | |
| Belleza Maldita (2020)/ | 2022-07-01 18:25 | - | |
| Ritual de Invierno (2018)/ | 2022-07-01 18:25 | - | |
| La princesa (2022)/ | 2022-07-01 21:10 | - | |
| Doors.2021/ | 2022-07-02 01:40 | - | |
| Beauty/ | 2022-07-02 01:40 | - | |
| Furry Friends Forever Elmo Gets a Puppy 2021/ | 2022-07-02 02:19 | - | |
| Megan is Missing 2011/ | 2022-07-03 17:28 | - | |
| Gatlopp/ | 2022-07-04 02:35 | - | |
| Money in the Bank/ | 2022-07-04 02:35 | - | |
| Journey to the West Conquering the Demons (Xi You Xiang Mo Pian)/ | 2022-07-04 02:35 | - | |
| Xi you ji Da nao tian gong/ | 2022-07-04 02:35 | - | |
| Ma Rainey s Black Bottom/ | 2022-07-04 02:35 | - | |
| Wolf/ | 2022-07-04 15:51 | - | |
| Je te veux moi non plus/ | 2022-07-04 15:56 | - | |
| Terror on the Prairie/ | 2022-07-04 15:59 | - | |
| Jurassic World Dominio (2022) Web-Rip HC 1080p/ | 2022-07-07 02:49 | - | |
| Hola, adiós y todo lo que pasó (2022)/ | 2022-07-07 16:14 | - | |
| Adventure Boyz/ | 2022-07-07 16:14 | - | |
| Be Careful What You Wish 4 (2021)/ | 2022-07-07 16:14 | - | |
| Dos Cataluñas (2018)/ | 2022-07-07 16:14 | - | |
| Eastern/ | 2022-07-07 16:14 | - | |
| Gekijouban Macross Delta Gekijou no Walkure (2018)/ | 2022-07-07 16:14 | - | |
| Gray Matter/ | 2022-07-07 16:14 | - | |
| Dragon Knight/ | 2022-07-07 16:14 | - | |
| Eating Animals (2017)/ | 2022-07-07 16:14 | - | |
| La calma que viene después/ | 2022-07-07 16:38 | - | |
| La Vidua Negra 2019/ | 2022-07-07 16:39 | - | |
| Las rojas (2021)/ | 2022-07-07 16:39 | - | |
| Las vacaciones de Potato) (2022)/ | 2022-07-07 16:43 | - | |
| Leonora addio (2022)/ | 2022-07-07 16:46 | - | |
| Les amours d’Anais (2021)/ | 2022-07-07 16:47 | - | |
| Mommy’s Cheating Scandal (2021)/ | 2022-07-07 16:47 | - | |
| Polina i tayemnyzia kinostudiyi/ | 2022-07-07 16:48 | - | |
| Quemar las naves (2021)/ | 2022-07-07 16:59 | - | |
| Russkiy Reyd (2020)/ | 2022-07-07 17:05 | - | |
| The Trip to Greece/ | 2022-07-07 17:06 | - | |
| Unhuman (2022)/ | 2022-07-07 17:16 | - | |
| Versus (Confrontación) (2019)/ | 2022-07-07 17:24 | - | |
| Ready or Not/ | 2022-07-08 04:51 | - | |
| Incantation/ | 2022-07-08 22:39 | - | |
| The Colour Room/ | 2022-07-08 22:39 | - | |
| The Sea Beast - El monstruo marino/ | 2022-07-08 23:39 | - | |
| Les Liaisons Dangereuses/ | 2022-07-08 23:39 | - | |
| Machine Gun Kelly s Life In Pink/ | 2022-07-08 23:40 | - | |
| Hot Seat/ | 2022-07-08 23:40 | - | |
| Galaxy Games/ | 2022-07-08 23:40 | - | |
| Girl in the Picture/ | 2022-07-08 23:40 | - | |
| The Underground Rock Experience/ | 2022-07-08 23:40 | - | |
| Burden/ | 2022-07-08 23:52 | - | |
| Bigfoot or Bust/ | 2022-07-08 23:57 | - | |
| 11th Hour Cleaning/ | 2022-07-08 23:57 | - | |
| the soloist/ | 2022-07-09 16:00 | - | |
| St. Vincent/ | 2022-07-09 18:16 | - | |
| Minions El origen de Gru/ | 2022-07-10 03:20 | - | |
| Greta/ | 2022-07-10 03:53 | - | |
| El acontecimiento/ | 2022-07-10 16:41 | - | |
| La Aventura Sobre Dos Ruedas/ | 2022-07-10 16:41 | - | |
| El hombre perfecto/ | 2022-07-10 16:41 | - | |
| Green Ghost and the Masters of the Stone/ | 2022-07-10 16:41 | - | |
| Dark Light/ | 2022-07-10 16:41 | - | |
| Instant Karma/ | 2022-07-10 16:41 | - | |
| A Beautiful Curse/ | 2022-07-10 16:57 | - | |
| 3 Demons/ | 2022-07-10 17:07 | - | |
| Mi identidad secreta/ | 2022-07-10 17:12 | - | |
| Para Chiara 2021/ | 2022-07-11 06:30 | - | |
| Doula/ | 2022-07-11 20:27 | - | |
| Malnazidos/ | 2022-07-11 20:27 | - | |
| Fur Jojo/ | 2022-07-11 20:27 | - | |
| The Bob's Burgers La pelicula/ | 2022-07-11 20:28 | - | |
| Comprometida hasta la muerte/ | 2022-07-12 03:21 | - | |
| Iberion/ | 2022-07-12 03:21 | - | |
| Lo que arde/ | 2022-07-12 03:21 | - | |
| Noche americana/ | 2022-07-12 03:21 | - | |
| Sergio LarraIN el instante eterno/ | 2022-07-12 03:21 | - | |
| Linterna Verde Teman a mi poder (2022/ | 2022-07-12 03:52 | - | |
| Bully mentes perdidas/ | 2022-07-13 06:17 | - | |
| Asking For It/ | 2022-07-13 18:51 | - | |
| Hello Again/ | 2022-07-13 18:51 | - | |
| L assassin de ma fille/ | 2022-07-13 18:51 | - | |
| Lost on Everest/ | 2022-07-13 18:51 | - | |
| Back to the Titanic/ | 2022-07-13 18:51 | - | |
| Most Wanted Sharks/ | 2022-07-13 19:02 | - | |
| Notre Dame/ | 2022-07-13 19:05 | - | |
| Penguins Life on the Edge/ | 2022-07-13 19:06 | - | |
| Sotto il sole di Amalfi/ | 2022-07-13 19:07 | - | |
| What the Shark/ | 2022-07-13 19:24 | - | |
| The Black Phone/ | 2022-07-14 16:36 | - | |
| Jurassic World- Dominio (2022) 1080p/ | 2022-07-14 16:37 | - | |
| El gran pase de magia/ | 2022-07-16 06:12 | - | |
| Persuasion/ | 2022-07-16 06:28 | - | |
| Zombies 3/ | 2022-07-16 06:32 | - | |
| Flee/ | 2022-07-16 18:00 | - | |
| Goodbye Butterfly/ | 2022-07-16 18:00 | - | |
| Il materiale emotivo/ | 2022-07-16 18:00 | - | |
| Pitbull Fuerza Bruta/ | 2022-07-16 18:00 | - | |
| Hereditary/ | 2022-07-17 17:56 | - | |
| everything everywhere all at once/ | 2022-07-21 18:19 | - | |
| Torn Hearts/ | 2022-07-22 03:42 | - | |
| Sestri/ | 2022-07-22 03:42 | - | |
| Mark Mary Y Some Other People/ | 2022-07-22 03:42 | - | |
| Za duzy na bajk/ | 2022-07-22 03:42 | - | |
| Rubius X (2022/ | 2022-07-23 04:34 | - | |
| The.Gray.Man/ | 2022-07-23 05:46 | - | |
| Mirreyes contra Godinez 2/ | 2022-07-25 17:39 | - | |
| Saint Seiya Heaven Chapter Overture (2004)/ | 2022-07-25 17:39 | - | |
| V.for.Vengeance/ | 2022-07-25 19:50 | - | |
| Downsizing/ | 2022-07-26 02:19 | - | |
| Si saben como me pongo Pa que me invitan 2/ | 2022-07-26 03:01 | - | |
| Law Abiding Citizen/ | 2022-07-26 20:31 | - | |
| Kalifornia (1993)/ | 2022-07-26 20:48 | - | |
| Flight of the Navigator (El vuelo del navegante) (1986)/ | 2022-07-26 20:51 | - | |
| Deadly House Call/ | 2022-07-28 18:26 | - | |
| Shut in/ | 2022-07-28 18:26 | - | |
| Pipa (2022)/ | 2022-07-28 18:26 | - | |
| Deadly Mom Retreat/ | 2022-07-28 18:26 | - | |
| Heart of Champions/ | 2022-07-29 17:47 | - | |
| Presidents/ | 2022-07-29 18:55 | - | |
| We Met in Virtual Reality/ | 2022-07-29 18:55 | - | |
| Everything Everywhere All at Once/ | 2022-07-30 16:50 | - | |
| Not Okay/ | 2022-07-30 18:22 | - | |
| Purple.Hearts/ | 2022-07-30 18:24 | - | |
| Barba Cabelo y Bigode/ | 2022-07-30 18:30 | - | |
| Dianas bryllup/ | 2022-07-30 18:55 | - | |
| Blackwood/ | 2022-07-30 18:55 | - | |
| Cinema Sabaya/ | 2022-07-30 18:55 | - | |
| A tiempo completo/ | 2022-07-30 18:55 | - | |
| Animals/ | 2022-07-30 18:55 | - | |
| Dem Horizont so nah/ | 2022-07-30 18:55 | - | |
| El dia del estreno Off/ | 2022-07-30 18:55 | - | |
| End Game/ | 2022-07-30 19:10 | - | |
| Friendship Never Dies/ | 2022-07-30 19:12 | - | |
| Girl Picture/ | 2022-07-30 19:12 | - | |
| Halloween Hero/ | 2022-07-30 19:13 | - | |
| Heavy Trip/ | 2022-07-30 19:13 | - | |
| Il paradiso del pavone/ | 2022-07-30 19:18 | - | |
| Le Temps des secrets/ | 2022-07-30 19:18 | - | |
| Mary for Mayor/ | 2022-07-30 19:23 | - | |
| On the line 보이스/ | 2022-07-30 19:23 | - | |
| Paradise Highway/ | 2022-07-30 19:27 | - | |
| Plaza Catedral/ | 2022-07-30 19:28 | - | |
| River Road/ | 2022-07-30 19:29 | - | |
| Rose/ | 2022-07-30 19:29 | - | |
| Shania Twain Not Just a Girl/ | 2022-07-30 19:32 | - | |
| Sniper The White Raven/ | 2022-07-30 19:39 | - | |
| Una femmina/ | 2022-07-30 19:40 | - | |
| The Break Up/ | 2022-07-30 20:15 | - | |
| Depredador/ | 2022-08-01 06:48 | - | |
| Predators (Depredadores) (2010)/ | 2022-08-01 06:48 | - | |
| Alien vs. Predator (2004)/ | 2022-08-01 06:48 | - | |
| The Predator (El Depredador) (2018)/ | 2022-08-01 07:09 | - | |
| Minions The Rise of Grua/ | 2022-08-02 17:52 | - | |
| tortugas ninja/ | 2022-08-03 18:13 | - | |
| Perempuan Tanah Jahanam/ | 2022-08-04 01:27 | - | |
| Que culpa tiene el karma/ | 2022-08-04 01:27 | - | |
| El buen vecino (2022/ | 2022-08-05 21:38 | - | |
| Carter.2022.WEB-DL.1080p/ | 2022-08-05 21:45 | - | |
| LEGO Star Wars Summer Vacation/ | 2022-08-05 23:08 | - | |
| L evenement/ | 2022-08-05 23:08 | - | |
| MODO HeROE (2021)/ | 2022-08-05 23:08 | - | |
| DARLINGS (2022)/ | 2022-08-05 23:08 | - | |
| El ascenso de las Tortugas Ninja La películ/ | 2022-08-05 23:08 | - | |
| Viajeros Perdidos en el tiempo/ | 2022-08-05 23:08 | - | |
| Doblemente embarazada/ | 2022-08-05 23:08 | - | |
| Buba (2022)/ | 2022-08-06 04:46 | - | |
| Carter.2022/ | 2022-08-06 04:49 | - | |
| Luck (2022)/ | 2022-08-06 04:56 | - | |
| La última marca (2022)/ | 2022-08-06 04:59 | - | |
| Depredador La presa (2022/ | 2022-08-06 05:55 | - | |
| Licorice Pizza/ | 2022-08-07 17:30 | - | |
| Elvis (2022)/ | 2022-08-08 16:47 | - | |
| La razón de estar contigo/ | 2022-08-09 03:34 | - | |
| a dogs Journey.2019/ | 2022-08-09 03:34 | - | |
| The Art of Racing in the Rain/ | 2022-08-09 03:34 | - | |
| La Princesa/ | 2022-08-11 18:07 | - | |
| Evil Stepmom/ | 2022-08-11 18:09 | - | |
| Birthmother s Betrayal/ | 2022-08-11 18:11 | - | |
| Super Bodyguard/ | 2022-08-11 19:11 | - | |
| Office Invasion/ | 2022-08-11 19:12 | - | |
| Las leyendas El origen/ | 2022-08-11 19:14 | - | |
| La nave The Ship/ | 2022-08-11 19:15 | - | |
| GOnUl Heartsong/ | 2022-08-11 19:15 | - | |
| Código Emperador (2022)/ | 2022-08-13 00:10 | - | |
| Day Shift (2022/ | 2022-08-13 00:10 | - | |
| 13 The Musical(2022/ | 2022-08-13 00:10 | - | |
| El Vuelo (Flight).2012/ | 2022-08-13 00:10 | - | |
| Goal saga/ | 2022-08-13 05:53 | - | |
| Stay on Board The Leo Baker Story/ | 2022-08-13 07:10 | - | |
| Snoopy presenta/ | 2022-08-13 07:19 | - | |
| Silver Spoon/ | 2022-08-13 07:20 | - | |
| Secret Headquarters/ | 2022-08-13 07:20 | - | |
| Rabid/ | 2022-08-13 07:21 | - | |
| Okko, el hostal y sus fantasmas/ | 2022-08-13 07:23 | - | |
| Mommy Would Never Hurt You/ | 2022-08-13 07:25 | - | |
| Helene/ | 2022-08-13 07:28 | - | |
| Catch the Fair One/ | 2022-08-13 07:39 | - | |
| Caged/ | 2022-08-13 07:40 | - | |
| Brian y Charles/ | 2022-08-13 07:40 | - | |
| Abuelos Principiantes/ | 2022-08-13 07:55 | - | |
| 3 Days with Dad/ | 2022-08-13 07:56 | - | |
| Paws of Fury/ | 2022-08-14 06:41 | - | |
| Help I Shrunk My Friends/ | 2022-08-15 06:00 | - | |
| La puerta de al lado/ | 2022-08-15 06:00 | - | |
| Peanuts Lucys School/ | 2022-08-15 06:00 | - | |
| Red Handed/ | 2022-08-15 06:00 | - | |
| Tendre et Saignant/ | 2022-08-15 06:00 | - | |
| Valentino/ | 2022-08-15 06:00 | - | |
| Gerda/ | 2022-08-15 06:08 | - | |
| Flag Day/ | 2022-08-15 06:15 | - | |
| Dual/ | 2022-08-15 06:20 | - | |
| CRECER APESTA/ | 2022-08-15 06:21 | - | |
| Compartimento N 6/ | 2022-08-15 06:25 | - | |
| This Is the Year/ | 2022-08-16 20:11 | - | |
| Top Gun Maverick (2022)/ | 2022-08-17 18:41 | - | |
| Cat Pack A PAW Patrol Exclusive Event/ | 2022-08-18 13:59 | - | |
| Look Both Ways/ | 2022-08-18 16:43 | - | |
| Royalteen/ | 2022-08-18 16:46 | - | |
| Studio 666/ | 2022-08-18 17:04 | - | |
| Falling/ | 2022-08-18 17:41 | - | |
| Inside the Mind of a Cat/ | 2022-08-18 17:41 | - | |
| True North/ | 2022-08-18 17:41 | - | |
| Looks Can Kill/ | 2022-08-18 18:44 | - | |
| Hunting Ava Bravo/ | 2022-08-20 05:29 | - | |
| Sniper Rogue Mission/ | 2022-08-20 05:29 | - | |
| The Next 365 Days/ | 2022-08-20 05:29 | - | |
| Tres metros sobre el cielo (2010)/ | 2022-08-23 17:30 | - | |
| DC League of Super Pets/ | 2022-08-23 18:49 | - | |
| Top Gun Maverick (2022/ | 2022-08-23 18:52 | - | |
| El sistema K.E.OPS (2022)/ | 2022-08-24 19:51 | - | |
| Vivir sin freno El turbulento mundo de John McAfee (2022)/ | 2022-08-24 19:51 | - | |
| Easter Sunday/ | 2022-08-24 19:51 | - | |
| Juntos son dinamita (2022)/ | 2022-08-24 19:51 | - | |
| Chico ventana también quisiera tener un submarino/ | 2022-08-24 19:51 | - | |
| Serpent Of Death/ | 2022-08-24 19:51 | - | |
| The Immaculate Room/ | 2022-08-24 20:07 | - | |
| The Secret of Sinchanee/ | 2022-08-24 20:11 | - | |
| RRR/ | 2022-08-24 20:19 | - | |
| This Much I Know to Be True/ | 2022-08-24 20:25 | - | |
| Untold The Rise and Fall of AND1/ | 2022-08-24 20:29 | - | |
| A punto de llegar/ | 2022-08-24 20:30 | - | |
| I m Being Me/ | 2022-08-24 20:36 | - | |
| Spin Me Round/ | 2022-08-24 20:37 | - | |
| Alcarras/ | 2022-08-24 20:38 | - | |
| Obscuro Despertar/ | 2022-08-24 20:42 | - | |
| Glorious/ | 2022-08-24 20:46 | - | |
| Shadow Wolves/ | 2022-08-24 20:46 | - | |
| Meteor/ | 2022-08-24 20:56 | - | |
| Le monde d hier/ | 2022-08-24 20:57 | - | |
| Fullmetal Alchemist La venganza de Cicatriz/ | 2022-08-24 21:00 | - | |
| Cami Lliure/ | 2022-08-24 21:01 | - | |
| Wrath.of.Man/ | 2022-08-25 17:33 | - | |
| Me case con un idiota/ | 2022-08-25 19:47 | - | |
| Dragevokterens jul/ | 2022-08-25 19:47 | - | |
| Nope/ | 2022-08-25 19:47 | - | |
| Kaamelott Premier volet/ | 2022-08-27 03:15 | - | |
| Samaritan/ | 2022-08-27 04:29 | - | |
| Tiempo para mi (2022)/ | 2022-08-31 23:48 | - | |
| I Came By/ | 2022-08-31 23:48 | - | |
| Mon Inconnue/ | 2022-08-31 23:59 | - | |
| Bixler High Private Eye/ | 2022-08-31 23:59 | - | |
| Le Dernier Voyage/ | 2022-08-31 23:59 | - | |
| Love.in.the.Villa.2022/ | 2022-09-01 20:09 | - | |
| Mack.and.Rita.2022/ | 2022-09-01 20:09 | - | |
| Summering.2022/ | 2022-09-01 20:09 | - | |
| First Love descubriendo el amor (2022)/ | 2022-09-02 18:25 | - | |
| Vecinos (2022/ | 2022-09-02 18:25 | - | |
| Bestia (2022)/ | 2022-09-02 18:25 | - | |
| Into the Deep (2022)/ | 2022-09-02 18:25 | - | |
| Romance en Verona (2022/ | 2022-09-02 18:25 | - | |
| Sully/ | 2022-09-03 17:24 | - | |
| Honk for Jesus Save Your Soul/ | 2022-09-04 03:52 | - | |
| Luzzu/ | 2022-09-04 03:52 | - | |
| Rodando hacia ti/ | 2022-09-04 03:52 | - | |
| The Aviary/ | 2022-09-04 03:52 | - | |
| Festival de trovadores/ | 2022-09-04 03:52 | - | |
| Eva y Beba y el fantasma del baNo de chicas/ | 2022-09-04 04:09 | - | |
| Eva y Beba Condenadas a bailar/ | 2022-09-04 04:13 | - | |
| Eva y Beba/ | 2022-09-04 04:14 | - | |
| Convoy 48/ | 2022-09-04 04:23 | - | |
| Archipiélago/ | 2022-09-04 04:26 | - | |
| Battle of the Bulge Winter War/ | 2022-09-04 04:49 | - | |
| Sensation/ | 2022-09-04 04:49 | - | |
| Desaparecidos Vanishing/ | 2022-09-04 04:49 | - | |
| Seúl a toda pastilla/ | 2022-09-04 04:49 | - | |
| Wire Room/ | 2022-09-04 04:49 | - | |
| Un paseo por las nubes/ | 2022-09-05 16:47 | - | |
| Get Smart With Money/ | 2022-09-08 00:31 | - | |
| La maniobra de la tortuga/ | 2022-09-08 00:31 | - | |
| The Harbinger/ | 2022-09-08 00:31 | - | |
| Untold Race of the Century/ | 2022-09-08 00:31 | - | |
| Veneciafrenia/ | 2022-09-08 00:31 | - | |
| Where the Crawdads Sing/ | 2022-09-08 00:31 | - | |
| Arde Notre Dame/ | 2022-09-08 00:45 | - | |
| Curious Caterer/ | 2022-09-08 00:47 | - | |
| Diorama/ | 2022-09-08 00:52 | - | |
| Éxodo La última marea/ | 2022-09-08 00:57 | - | |
| Pinocho.(2022/ | 2022-09-09 00:55 | - | |
| Welcome to the Club/ | 2022-09-10 05:14 | - | |
| BTS PERMISSION TO DANCE/ | 2022-09-11 17:31 | - | |
| FlightRisk/ | 2022-09-11 23:26 | - | |
| Blood Brothers/ | 2022-09-11 23:59 | - | |
| End of the Road/ | 2022-09-11 23:59 | - | |
| Horrible Histories The Movie/ | 2022-09-11 23:59 | - | |
| Obi-Wan Kenobi El retorno de un jedi/ | 2022-09-11 23:59 | - | |
| Presencias/ | 2022-09-11 23:59 | - | |
| Red Snow/ | 2022-09-12 00:09 | - | |
| Sous emprise/ | 2022-09-12 00:17 | - | |
| American Me/ | 2022-09-12 17:32 | - | |
| El Mundo de las Spice Girls/ | 2022-09-12 21:11 | - | |
| See for Me/ | 2022-09-13 19:27 | - | |
| Aika jonka sain/ | 2022-09-13 19:27 | - | |
| The Secrets She Keeps/ | 2022-09-13 19:27 | - | |
| Alice no Mundo da Internet/ | 2022-09-13 19:27 | - | |
| Pom Poms and Payback/ | 2022-09-13 19:27 | - | |
| Hidden Family Secrets/ | 2022-09-13 19:27 | - | |
| I Won’t Let You Go/ | 2022-09-13 19:27 | - | |
| Good Mourning/ | 2022-09-16 23:11 | - | |
| Goodnight Mommy/ | 2022-09-16 23:11 | - | |
| Honor Society/ | 2022-09-16 23:11 | - | |
| I Used to be Famous/ | 2022-09-16 23:11 | - | |
| Big Game LAT/ | 2022-09-16 23:59 | - | |
| Revancha ya (2022)/ | 2022-09-17 02:21 | - | |
| The Invitation (2022)/ | 2022-09-17 02:21 | - | |
| The Ghost and the Darkness/ | 2022-09-23 03:41 | - | |
| Jujutsu Kaisen 0/ | 2022-09-23 03:57 | - | |
| Miénteme/ | 2022-09-23 19:18 | - | |
| Pokémon Las crónicas de Arceus (2022)/ | 2022-09-24 00:37 | - | |
| A Jazzman s Blues/ | 2022-09-25 23:29 | - | |
| Atenea/ | 2022-09-25 23:29 | - | |
| Amants/ | 2022-09-25 23:29 | - | |
| Bekenntnisse des Hochstaplers Felix Krull/ | 2022-09-25 23:29 | - | |
| Bodies Bodies Bodies/ | 2022-09-25 23:29 | - | |
| Bullet Proof/ | 2022-09-25 23:43 | - | |
| Cadejo Blanco/ | 2022-09-25 23:44 | - | |
| Death of a Vlogge/ | 2022-09-25 23:49 | - | |
| Declaración de emergencia/ | 2022-09-25 23:51 | - | |
| Der Parfumeur/ | 2022-09-25 23:53 | - | |
| Firebird/ | 2022-09-25 23:57 | - | |
| Fullmetal Alchemist La alquimia final/ | 2022-09-26 00:03 | - | |
| Hommes au bord de la crise de nerfs/ | 2022-09-26 00:06 | - | |
| Jim Knopf und Lukas der Lokomotivführer/ | 2022-09-26 00:13 | - | |
| König der Raben/ | 2022-09-26 00:15 | - | |
| Los Smiling Friends van a Brazil/ | 2022-09-26 00:17 | - | |
| Lou/ | 2022-09-26 00:19 | - | |
| Mortal Kombat Legends Snow Blind/ | 2022-09-26 00:23 | - | |
| Por los pelos/ | 2022-09-26 00:27 | - | |
| Section 8/ | 2022-09-26 00:30 | - | |
| Sundown/ | 2022-09-26 00:33 | - | |
| Tenéis que venir a verla/ | 2022-09-26 00:38 | - | |
| The Enforcer/ | 2022-09-26 00:38 | - | |
| The Ex/ | 2022-09-26 00:41 | - | |
| The Infernal Machine/ | 2022-09-26 00:42 | - | |
| Bullet Train/ | 2022-09-27 00:13 | - | |
| Minions and More 1/ | 2022-09-27 18:53 | - | |
| A Trip to Infinity/ | 2022-09-29 03:21 | - | |
| Rubia (2022)/ | 2022-09-29 03:21 | - | |
| My Best Friend’s Exorcism/ | 2022-09-30 18:07 | - | |
| Don’t Worry Darling/ | 2022-09-30 18:07 | - | |
| Switched/ | 2022-09-30 20:04 | - | |
| Der Pfad/ | 2022-10-01 01:05 | - | |
| Barbie Mermaid Power/ | 2022-10-04 17:23 | - | |
| Ships in the Night A Marthas Vineyard Mystery/ | 2022-10-04 17:26 | - | |
| What We Leave Behind/ | 2022-10-04 17:27 | - | |
| Bel Canto/ | 2022-10-04 17:30 | - | |
| El hombre que vendio su piel/ | 2022-10-04 17:59 | - | |
| Jeepers Creepers Reborn/ | 2022-10-04 18:01 | - | |
| Anikulapo/ | 2022-10-04 18:04 | - | |
| Entergalactic/ | 2022-10-04 18:09 | - | |
| Gods Creatures/ | 2022-10-04 18:27 | - | |
| Padre no hay mas que Uno 3 LAT/ | 2022-10-04 18:32 | - | |
| Vesper/ | 2022-10-04 18:35 | - | |
| Nahuel y el libro magico/ | 2022-10-04 18:39 | - | |
| The Greatest Beer Run Ever/ | 2022-10-04 23:54 | - | |
| Orphan First Kill/ | 2022-10-06 04:24 | - | |
| Beetlejuice (1988)/ | 2022-10-06 04:24 | - | |
| La Familia Munster (2022)/ | 2022-10-06 05:11 | - | |
| Mr. Harrigan's Phone/ | 2022-10-06 05:14 | - | |
| Jumping from High Places/ | 2022-10-06 05:39 | - | |
| Togo/ | 2022-10-06 05:45 | - | |
| La conferencia/ | 2022-10-06 05:54 | - | |
| Nitram/ | 2022-10-06 05:54 | - | |
| Werewolf by Night/ | 2022-10-08 05:34 | - | |
| Monster High The Movie/ | 2022-10-08 05:34 | - | |
| Catherine Called Birdy/ | 2022-10-08 06:09 | - | |
| The Trapped 13/ | 2022-10-08 06:17 | - | |
| The Joys and Sorrows of Young Yuguo/ | 2022-10-08 06:17 | - | |
| Radioflash/ | 2022-10-08 06:17 | - | |
| The Redeem Team/ | 2022-10-08 06:24 | - | |
| Halloween_Ends_2022/ | 2022-10-15 00:27 | - | |
| Crawlspace/ | 2022-10-19 01:15 | - | |
| Bros/ | 2022-10-19 01:16 | - | |
| Cerdita/ | 2022-10-19 01:16 | - | |
| Clerks III/ | 2022-10-19 01:16 | - | |
| Code Name Banshee/ | 2022-10-19 01:16 | - | |
| Blackout/ | 2022-10-19 01:16 | - | |
| Dark Web Cicada 3301/ | 2022-10-19 01:30 | - | |
| El Vestido De La Novia/ | 2022-10-19 01:31 | - | |
| Homebound/ | 2022-10-19 01:34 | - | |
| La Gran Aventura de Los Lunnis y el Libro Mágico/ | 2022-10-19 01:35 | - | |
| Old Man/ | 2022-10-19 01:41 | - | |
| Peace by Chocolate/ | 2022-10-19 01:43 | - | |
| Rosaline/ | 2022-10-19 01:45 | - | |
| Seance/ | 2022-10-19 01:49 | - | |
| Shin Ultraman/ | 2022-10-19 01:49 | - | |
| The Curse of Bridge Hollow/ | 2022-10-19 01:50 | - | |
| The Inhabitant/ | 2022-10-19 01:55 | - | |
| The Mystery of Green Hill/ | 2022-10-19 02:00 | - | |
| The Phantom of the Open/ | 2022-10-19 02:03 | - | |
| Un crimen argentino/ | 2022-10-19 02:11 | - | |
| Luckiest Girl Alive/ | 2022-10-19 02:14 | - | |
| La escuela del bien y del mal/ | 2022-10-19 19:23 | - | |
| Draculito y Draculero/ | 2022-10-21 02:08 | - | |
| Silent Night/ | 2022-10-21 02:08 | - | |
| The Bygone/ | 2022-10-21 02:08 | - | |
| The Obscure Life of the Grand Duke of Corsicaaka/ | 2022-10-21 02:08 | - | |
| LECCIONES PARA DOMAR A UN MACHO/ | 2022-10-21 02:08 | - | |
| The Stranger/ | 2022-10-21 02:08 | - | |
| Raymond.and.Ray.2022/ | 2022-10-22 17:32 | - | |
| VHS99/ | 2022-10-22 17:58 | - | |
| Hora de Brilhar/ | 2022-10-23 01:18 | - | |
| Mothering Sunday/ | 2022-10-23 01:18 | - | |
| Spirit Halloween The Movie/ | 2022-10-23 01:18 | - | |
| Meandre/ | 2022-10-23 20:16 | - | |
| El tubo/ | 2022-10-23 21:11 | - | |
| Las Vocales/ | 2022-10-25 03:45 | - | |
| Ticket to Paradise (2022) INGLES/ | 2022-10-25 04:44 | - | |
| Book of Love (2022)/ | 2022-10-25 04:44 | - | |
| Don't Worry Darling (2022/ | 2022-10-25 04:44 | - | |
| Jaula/ | 2022-10-25 04:44 | - | |
| 20th Century Girl/ | 2022-10-26 03:43 | - | |
| The Requin/ | 2022-10-27 19:48 | - | |
| The Good Nurse/ | 2022-10-27 19:48 | - | |
| Bonita (2022)/ | 2022-10-27 19:48 | - | |
| Más allá del universo (2022)/ | 2022-10-27 19:48 | - | |
| La Casa del Crimen (2022)/ | 2022-10-27 19:48 | - | |
| Whisper/ | 2022-10-27 21:27 | - | |
| So Cold the River/ | 2022-10-27 21:34 | - | |
| Escalera al Infierno/ | 2022-10-27 21:41 | - | |
| Ostatnia wieczerza/ | 2022-10-27 21:46 | - | |
| Rapiniamo il Duce/ | 2022-10-27 21:49 | - | |
| DRÁCULA AÚN ESTÁ VIVO (2022)/ | 2022-10-28 01:00 | - | |
| EL NORTE SOBRE EL VACÍO/ | 2022-10-28 01:00 | - | |
| ANA Y BRUNO/ | 2022-10-29 02:19 | - | |
| Wendell and Wild/ | 2022-10-29 02:19 | - | |
| Mete miedo/ | 2022-10-29 04:37 | - | |
| Wild Is the Wind/ | 2022-10-29 04:52 | - | |
| Voy a pasarmelo bien/ | 2022-10-30 03:42 | - | |
| The Bad Seed Returns/ | 2022-10-30 03:46 | - | |
| COLORS LAT/ | 2022-10-30 04:00 | - | |
| Soy Tu Fan la pelicula/ | 2022-10-30 18:13 | - | |
| Mamá para rato (2022)/ | 2022-11-02 18:13 | - | |
| Camino a la gloria (2006)/ | 2022-11-02 18:13 | - | |
| Gags The Clown/ | 2022-11-02 18:13 | - | |
| The Takeover/ | 2022-11-02 19:23 | - | |
| Mira cómo corren (2022)/ | 2022-11-02 19:31 | - | |
| Intergalactic Meeting/ | 2022-11-04 17:46 | - | |
| Enola Holmes 2/ | 2022-11-04 17:53 | - | |
| Hostile Territory/ | 2022-11-04 18:00 | - | |
| Last Seen Alive/ | 2022-11-04 18:00 | - | |
| Mi Policía (2022)/ | 2022-11-04 18:00 | - | |
| Resurgir (2022)/ | 2022-11-04 18:00 | - | |
| Sobredosis (2022)/ | 2022-11-04 18:13 | - | |
| The Last Thing Mary Saw/ | 2022-11-04 18:17 | - | |
| Emily the Criminal/ | 2022-11-05 22:15 | - | |
| Wunderschön/ | 2022-11-05 22:15 | - | |
| Orgasm Inc The Story of OneTaste/ | 2022-11-05 22:15 | - | |
| Le Befana vien di notte Le origini/ | 2022-11-05 22:15 | - | |
| CORRIENDO HACIA TI (2022)/ | 2022-11-05 22:15 | - | |
| Elesin Oba/ | 2022-11-06 22:03 | - | |
| Matriarch/ | 2022-11-06 22:03 | - | |
| Margaux/ | 2022-11-10 19:36 | - | |
| Una peli de fútbol... y mutantes (2022)/ | 2022-11-10 19:36 | - | |
| Balle perdue 2/ | 2022-11-10 19:36 | - | |
| Selena Gomez mi mente y yo/ | 2022-11-10 19:36 | - | |
| Addio al nubilato/ | 2022-11-10 19:36 | - | |
| Navidad de Golpe (2022)/ | 2022-11-10 19:36 | - | |
| La caída/ | 2022-11-11 20:30 | - | |
| My Fathers Dragon 2022/ | 2022-11-11 20:30 | - | |
| Amsterdam/ | 2022-11-11 20:30 | - | |
| Kal/ | 2022-11-11 20:30 | - | |
| State of Alabama vs. Brittany Smith/ | 2022-11-11 20:30 | - | |
| Capturing the Killer Nurse/ | 2022-11-11 20:30 | - | |
| Monica O My Darling/ | 2022-11-11 20:30 | - | |
| Black Adam Savior or Destroyer 2022/ | 2022-11-13 00:27 | - | |
| Weird The Al Yankovic Story/ | 2022-11-14 10:10 | - | |
| Tadeo Jones 3/ | 2022-11-14 10:10 | - | |
| The Visitor/ | 2022-11-18 07:13 | - | |
| A Christmas Story Christmas/ | 2022-11-18 07:13 | - | |
| Black Adam/ | 2022-11-18 07:13 | - | |
| Cuando sea joven/ | 2022-11-18 07:13 | - | |
| Busco novia/ | 2022-11-18 17:32 | - | |
| The People We Hate at the Wedding/ | 2022-11-18 17:32 | - | |
| Desencantada Vuelve Giselle/ | 2022-11-18 18:54 | - | |
| Spirited/ | 2022-11-19 03:17 | - | |
| Secret in Their Eyes/ | 2022-11-19 04:30 | - | |
| Slumberland/ | 2022-11-19 04:30 | - | |
| Una rubia muy legal 2/ | 2022-11-19 04:30 | - | |
| Replicas/ | 2022-11-19 04:30 | - | |
| Killing Them Softly/ | 2022-11-19 04:30 | - | |
| premonición/ | 2022-11-19 04:30 | - | |
| Boogie Woogie/ | 2022-11-19 04:45 | - | |
| Título Blue s Big City Adventure/ | 2022-11-20 03:32 | - | |
| Fifty Shades of Grey/ | 2022-11-22 10:44 | - | |
| Fifty Shades Darker/ | 2022-11-22 10:44 | - | |
| Fifty Shades Freed/ | 2022-11-22 10:44 | - | |
| The Woman KingHD1080/ | 2022-11-24 17:01 | - | |
| Amores permitidos (2022)/ | 2022-11-25 05:47 | - | |
| Christmas Unfiltered/ | 2022-11-25 05:47 | - | |
| A Christmas Mystery/ | 2022-11-25 05:47 | - | |
| El Guau/ | 2022-11-25 05:47 | - | |
| Holiday Harmony/ | 2022-11-25 05:47 | - | |
| The Noel Diary/ | 2022-11-25 05:47 | - | |
| Payback/ | 2022-11-25 05:47 | - | |
| Guardianes de la Galaxia Especial de las Fiestas (2022)/ | 2022-11-26 05:40 | - | |
| Christmas on Mistletoe Farm/ | 2022-11-26 05:44 | - | |
| Christmas With You/ | 2022-11-26 05:47 | - | |
| The Swimmers/ | 2022-11-26 05:50 | - | |
| A Christmas Proposal/ | 2022-11-27 22:40 | - | |
| Reefa/ | 2022-11-27 22:40 | - | |
| El paciente/ | 2022-11-27 22:40 | - | |
| Plan lekcji - Lesson Plan/ | 2022-11-27 22:40 | - | |
| Huracan/ | 2022-11-27 22:40 | - | |
| Survivor Series WarGames/ | 2022-11-27 22:40 | - | |
| Sword Art Online Progressive Aria oF a Starless Night.2021/ | 2022-11-27 22:40 | - | |
| Meet Cute (2022)/ | 2022-11-27 22:40 | - | |
| Lilo mi amigo el cocodrilo/ | 2022-11-27 22:40 | - | |
| Christmas in Paradise.2022/ | 2022-11-28 15:21 | - | |
| Under Wraps- Una Momia en Halloween 2 (2022)/ | 2022-11-28 15:21 | - | |
| El corazOn de Europa/ | 2022-11-29 06:35 | - | |
| Entre la vie et la mort/ | 2022-11-29 06:35 | - | |
| Ghislaine Maxwell Filthy Rich/ | 2022-11-29 06:35 | - | |
| Action Pack Saves Christmas/ | 2022-11-29 06:53 | - | |
| Nobody Has to Know/ | 2022-12-02 04:51 | - | |
| Una Navidad llena de Gracia/ | 2022-12-02 04:51 | - | |
| Super hEros malgrE lui/ | 2022-12-02 04:51 | - | |
| Troll/ | 2022-12-02 04:51 | - | |
| Un hombre de acción/ | 2022-12-02 04:51 | - | |
| Spasti Leningrad/ | 2022-12-02 04:51 | - | |
| Me llamo venganza/ | 2022-12-02 05:13 | - | |
| Master of Light/ | 2022-12-02 05:15 | - | |
| La Fracture/ | 2022-12-02 05:25 | - | |
| Franklin historia de un billete/ | 2022-12-02 05:32 | - | |
| Fly/ | 2022-12-02 05:34 | - | |
| Du som er i himlen/ | 2022-12-02 05:40 | - | |
| Warriors of Future/ | 2022-12-02 19:51 | - | |
| No abras la puerta/ | 2022-12-02 19:51 | - | |
| Julemandens datter 2/ | 2022-12-02 19:51 | - | |
| Scrooge A Christmas Carol/ | 2022-12-02 19:51 | - | |
| Diary of a Wimpy Kid Rodrick Rules/ | 2022-12-02 19:51 | - | |
| El sueno de ayer/ | 2022-12-02 19:51 | - | |
| Cube/ | 2022-12-02 19:51 | - | |
| Christmas Time Is Here/ | 2022-12-02 19:51 | - | |
| Lady Chatterley s Lover/ | 2022-12-02 19:52 | - | |
| Calibro 9/ | 2022-12-02 20:26 | - | |
| Bar Fight/ | 2022-12-02 20:29 | - | |
| Angel Falls Christmas/ | 2022-12-02 20:33 | - | |
| A Kindhearted Christmas/ | 2022-12-02 20:35 | - | |
| A Christmas Miracle for Daisy/ | 2022-12-02 20:44 | - | |
| Singwa Hamgge Along with the Gods The Two Worlds/ | 2022-12-05 20:59 | - | |
| The Independent/ | 2022-12-05 20:59 | - | |
| CERO Y VAN CUATRO/ | 2022-12-05 20:59 | - | |
| Osmosis Jones/ | 2022-12-05 20:59 | - | |
| Reign of Fire/ | 2022-12-06 03:53 | - | |
| El extra navideño del bebé jefazo/ | 2022-12-07 05:33 | - | |
| Jeszcze przed swietami/ | 2022-12-07 05:33 | - | |
| She Said/ | 2022-12-07 05:33 | - | |
| Con canas y a lo loco/ | 2022-12-08 04:28 | - | |
| Matrimillas/ | 2022-12-08 04:28 | - | |
| Mission Sky/ | 2022-12-08 06:31 | - | |
| Hawa/ | 2022-12-10 02:54 | - | |
| Night at the Museum Kahmunrah Rises Again/ | 2022-12-10 02:54 | - | |
| Pinocho de Guillermo del Toro/ | 2022-12-10 02:54 | - | |
| Topside/ | 2022-12-10 02:54 | - | |
| Something from Tiffany s/ | 2022-12-10 02:54 | - | |
| Huevitos congelados/ | 2022-12-10 04:46 | - | |
| The Novice/ | 2022-12-10 07:03 | - | |
| One Night in Bangkok/ | 2022-12-10 07:03 | - | |
| Navidad en Vivo/ | 2022-12-10 07:03 | - | |
| Es ist nur eine Phase, Hase/ | 2022-12-10 07:03 | - | |
| Libélulas/ | 2022-12-10 07:03 | - | |
| Contra/ | 2022-12-10 07:03 | - | |
| Reyes contra Santa/ | 2022-12-10 21:04 | - | |
| It s A Wonderful Binge/ | 2022-12-10 21:04 | - | |
| Pinocchio/ | 2022-12-12 20:47 | - | |
| The Water Diviner/ | 2022-12-13 03:23 | - | |
| The Big 4/ | 2022-12-15 17:32 | - | |
| I Believe in Santa/ | 2022-12-15 17:38 | - | |
| Solo amor y mil canciones/ | 2022-12-15 17:46 | - | |
| Emancipation Hacia la libertad/ | 2022-12-16 21:32 | - | |
| Violent Night/ | 2022-12-20 18:45 | - | |
| Nanny (2022)/ | 2022-12-20 18:47 | - | |
| Mindcage/ | 2022-12-20 18:47 | - | |
| The Apology/ | 2022-12-20 18:47 | - | |
| Los Reyes Magos La verdad/ | 2022-12-20 18:47 | - | |
| Herida del Corazon/ | 2022-12-20 18:48 | - | |
| Clases particulares/ | 2022-12-20 18:57 | - | |
| The Seven Deadly Sins Grudge of Edinburgh/ | 2022-12-20 19:28 | - | |
| Reviviendo la Navidad/ | 2022-12-20 19:29 | - | |
| Corazonada (2022)/ | 2022-12-20 19:31 | - | |
| After Masks/ | 2022-12-22 19:43 | - | |
| Bromates/ | 2022-12-22 19:43 | - | |
| El Matador Mision de Rescate/ | 2022-12-22 19:43 | - | |
| Gingerbread Miracle/ | 2022-12-22 19:43 | - | |
| Potter s Ground/ | 2022-12-22 19:43 | - | |
| SHE WAS THE DEPUTY’S WIFE/ | 2022-12-22 19:43 | - | |
| The Immortal Wars Rebirth/ | 2022-12-22 19:43 | - | |
| Ride Like a Girl/ | 2022-12-22 20:00 | - | |
| Prey for the Devil/ | 2022-12-22 20:09 | - | |
| Queen of the Amazon/ | 2022-12-22 20:15 | - | |
| Once Upon a Time in Tombstone/ | 2022-12-22 20:19 | - | |
| Strange World/ | 2022-12-23 17:57 | - | |
| Men/ | 2022-12-23 19:39 | - | |
| The Boy, the Mole, the Fox and the Horse/ | 2022-12-30 20:29 | - | |
| Los renglones torcidos de Dios/ | 2022-12-30 22:28 | - | |
| Roald Dahl s Matilda the Musical/ | 2022-12-30 22:28 | - | |
| Una noche en la escuela/ | 2022-12-30 22:28 | - | |
| 7 donne e un mistero/ | 2022-12-30 22:28 | - | |
| Hansel Y Gretel After Ever After/ | 2022-12-30 22:28 | - | |
| Happy Nous Year/ | 2022-12-30 22:28 | - | |
| Mal de Ojo/ | 2022-12-30 22:28 | - | |
| Nightride/ | 2022-12-30 22:28 | - | |
| The Amazing Mr. Blunden/ | 2022-12-30 22:28 | - | |
| Encanto en el Hollywood Bowl/ | 2023-01-03 05:08 | - | |
| Desaparecido a medianoche/ | 2023-01-03 19:35 | - | |
| Perdidos en el tiempo/ | 2023-01-03 19:35 | - | |
| Ruido de fondo/ | 2023-01-03 19:36 | - | |
| Todo el mundo odia a Johan/ | 2023-01-03 19:36 | - | |
| Viviendo juntos/ | 2023-01-03 19:49 | - | |
| The Menu/ | 2023-01-04 02:21 | - | |
| Tales from the Occult/ | 2023-01-04 02:21 | - | |
| The Dog Lovers Guide to Dating/ | 2023-01-04 02:21 | - | |
| Mumbai Mafia Police vs the Underworld/ | 2023-01-06 22:15 | - | |
| 7th Secret/ | 2023-01-06 23:12 | - | |
| The Pale Blue Eye/ | 2023-01-07 00:08 | - | |
| Call Jane/ | 2023-01-09 18:19 | - | |
| Girl at the Window/ | 2023-01-09 18:19 | - | |
| Inspector araña/ | 2023-01-09 18:19 | - | |
| Las Caras de la Verdad (2022)/ | 2023-01-09 18:28 | - | |
| The Age of Adaline/ | 2023-01-09 21:03 | - | |
| the volcano rescue from whakaari/ | 2023-01-09 21:31 | - | |
| Piktuju Karta (The Generation of Evil) (2021)/ | 2023-01-10 18:30 | - | |
| Olga (2021)/ | 2023-01-10 18:30 | - | |
| Las gentiles (2021)/ | 2023-01-10 18:32 | - | |
| La casa entre los cactus (2022)/ | 2023-01-10 18:33 | - | |
| First Cow (2019)/ | 2023-01-10 18:34 | - | |
| Deliver Us from Evil (2020)/ | 2023-01-10 18:35 | - | |
| All My Friends Hate Me (2021)/ | 2023-01-10 18:45 | - | |
| The Hatchet Wielding Hitchhiker/ | 2023-01-12 05:12 | - | |
| Sinjar/ | 2023-01-12 06:57 | - | |
| Ruido/ | 2023-01-12 06:57 | - | |
| El Aro Resurreccion/ | 2023-01-12 06:57 | - | |
| La novia de América/ | 2023-01-12 06:57 | - | |
| Creed La leyenda de Rocky/ | 2023-01-12 07:40 | - | |
| El Aro Resurrección (2020)/ | 2023-01-12 19:27 | - | |
| Desconectados/ | 2023-01-12 19:27 | - | |
| El protector - The Enforcer/ | 2023-01-13 05:01 | - | |
| De piraten van hiernaast/ | 2023-01-13 05:02 | - | |
| Ask Me to Dance/ | 2023-01-13 05:12 | - | |
| Iluzja/ | 2023-01-13 05:13 | - | |
| Funny Farm/ | 2023-01-13 05:13 | - | |
| Objetos/ | 2023-01-13 05:13 | - | |
| Pahanhautoja (2022)/ | 2023-01-13 05:13 | - | |
| Psycho-Pass Sinners of the System (2019)/ | 2023-01-13 05:13 | - | |
| The Amaranth/ | 2023-01-13 05:22 | - | |
| The City of Gold/ | 2023-01-13 05:25 | - | |
| Unplanned/ | 2023-01-13 05:26 | - | |
| Utama/ | 2023-01-13 05:26 | - | |
| Victoria Gotti My Father's Daughter/ | 2023-01-13 05:28 | - | |
| Zoya (2021)/ | 2023-01-13 05:30 | - | |
| Identity Thief/ | 2023-01-13 20:57 | - | |
| 1 Mile To You 2017/ | 2023-01-14 19:05 | - | |
| 70 Binladens 2019/ | 2023-01-14 19:09 | - | |
| A Sisters Secret 2018/ | 2023-01-14 19:10 | - | |
| Airplane 1980/ | 2023-01-14 19:10 | - | |
| Au bout des doigts 2018/ | 2023-01-14 19:11 | - | |
| Calm Before/ | 2023-01-14 19:12 | - | |
| Dead in the Water 2018/ | 2023-01-14 19:12 | - | |
| El hijo 2019/ | 2023-01-14 19:13 | - | |
| Flubber 1997/ | 2023-01-14 19:14 | - | |
| Killer High 2018/ | 2023-01-14 19:18 | - | |
| La Aldea Siniestra 2022/ | 2023-01-14 19:21 | - | |
| La boda de mi mejor amigo 2019/ | 2023-01-14 19:21 | - | |
| Las niNas bien 2019/ | 2023-01-14 19:22 | - | |
| Le Chant du loup 2019/ | 2023-01-14 19:26 | - | |
| Liliane Susewind - Ein tierisches Abenteuer/ | 2023-01-14 19:27 | - | |
| My Teacher My Obsession 2018/ | 2023-01-14 19:29 | - | |
| She s Out of My League/ | 2023-01-14 19:34 | - | |
| Test 2013/ | 2023-01-14 19:37 | - | |
| The Adventures of Robin Hood 1938/ | 2023-01-14 19:37 | - | |
| The Great Hack 2019/ | 2023-01-14 19:37 | - | |
| The Hole in the Ground 2019/ | 2023-01-14 19:38 | - | |
| The Man Who Killed Don Quixote/ | 2023-01-14 19:38 | - | |
| Youjo Senki The Movie/ | 2023-01-14 19:40 | - | |
| The Aftermath/ | 2023-01-14 19:43 | - | |
| Devotion/ | 2023-01-15 00:01 | - | |
| The Time Capsule/ | 2023-01-15 00:01 | - | |
| The Old Way/ | 2023-01-16 21:10 | - | |
| Disconnect The Wedding Planner/ | 2023-01-16 21:14 | - | |
| Dog Gone/ | 2023-01-16 21:19 | - | |
| Snow Falls/ | 2023-01-19 19:14 | - | |
| House Party/ | 2023-01-19 21:03 | - | |
| JUNG_E/ | 2023-01-20 21:53 | - | |
| El rey Shakir/ | 2023-01-20 21:53 | - | |
| La escuela catolica/ | 2023-01-21 02:14 | - | |
| The Banshees of Inisherin/ | 2023-01-21 02:18 | - | |
| Narvik (2022)/ | 2023-01-24 18:27 | - | |
| Legiones/ | 2023-01-24 18:27 | - | |
| The 13th Warrior/ | 2023-01-26 04:17 | - | |
| Detective Knight Independence/ | 2023-01-26 06:38 | - | |
| La cena perfecta/ | 2023-01-26 06:38 | - | |
| Transfusion/ | 2023-01-26 06:38 | - | |
| Bank of Dave/ | 2023-01-26 17:27 | - | |
| Battlebox/ | 2023-01-26 17:27 | - | |
| Willow Behind the Magic/ | 2023-01-26 17:27 | - | |
| Mírame (2021/ | 2023-01-27 06:55 | - | |
| Asústame (2020)/ | 2023-01-27 07:06 | - | |
| Lupin III vs Ojos de Gato (2023)/ | 2023-01-27 07:07 | - | |
| Darby and the Dead/ | 2023-01-27 19:46 | - | |
| Shotgun Wedding/ | 2023-01-27 19:47 | - | |
| You People/ | 2023-01-28 18:39 | - | |
| Night Hunt/ | 2023-01-29 18:08 | - | |
| The Mummy Resurrection/ | 2023-01-29 18:08 | - | |
| In Dreams/ | 2023-01-29 18:08 | - | |
| The Winter Witch/ | 2023-01-29 18:08 | - | |
| Werewolf Cabal/ | 2023-01-29 18:08 | - | |
| Undeaducated/ | 2023-01-29 18:08 | - | |
| Those Who Call/ | 2023-01-29 18:08 | - | |
| Waking Karma/ | 2023-01-29 18:08 | - | |
| Jije/ | 2023-01-29 18:08 | - | |
| Night of the Falling Stars/ | 2023-01-29 18:08 | - | |
| 5G The Reckoning/ | 2023-01-29 18:17 | - | |
| Toxic/ | 2023-01-29 18:21 | - | |
| Night Train/ | 2023-01-29 18:23 | - | |
| The 3rd Guest/ | 2023-01-29 18:23 | - | |
| Carnifex/ | 2023-01-29 18:24 | - | |
| Bring Out the Fear/ | 2023-01-29 18:24 | - | |
| Natale a tutti i costi/ | 2023-01-29 18:27 | - | |
| Shark Waters/ | 2023-01-29 18:34 | - | |
| Battle for Pandora/ | 2023-01-29 18:37 | - | |
| Bleach/ | 2023-01-29 18:39 | - | |
| Devil Beneath/ | 2023-01-29 18:40 | - | |
| Rocky 3/ | 2023-01-30 04:27 | - | |
| Rocky 4/ | 2023-01-30 04:27 | - | |
| Rocky 5/ | 2023-01-30 04:27 | - | |
| Rocky Balboa/ | 2023-01-30 04:27 | - | |
| Rocky 2/ | 2023-01-30 04:41 | - | |
| Rocky 1/ | 2023-01-30 04:42 | - | |
| Pantera Negra- Wakanda por Siempre (2022)/ | 2023-01-31 02:47 | - | |
| Jack El Cazagigantes/ | 2023-01-31 08:06 | - | |
| Beneath the Green/ | 2023-01-31 20:56 | - | |
| Delusional/ | 2023-01-31 20:56 | - | |
| Pamela A Love Story/ | 2023-01-31 20:56 | - | |
| The Banker/ | 2023-02-02 17:52 | - | |
| Love in Glacier National A National Park Romance/ | 2023-02-02 17:52 | - | |
| A Bronx Tale/ | 2023-02-02 18:18 | - | |
| Speak No Evil/ | 2023-02-03 02:32 | - | |
| Rock Dog 3 Battle the Beat/ | 2023-02-03 02:45 | - | |
| Le Tour du monde en 80 jours/ | 2023-02-03 19:33 | - | |
| Nix (2022)/ | 2023-02-03 19:33 | - | |
| Sam Kate/ | 2023-02-03 19:33 | - | |
| True Spirit/ | 2023-02-03 19:33 | - | |
| Prizefighter The Life of Jem Belcher/ | 2023-02-03 19:33 | - | |
| Atrapadas en familia/ | 2023-02-03 19:33 | - | |
| Viking Wolf/ | 2023-02-03 19:33 | - | |
| The Crush/ | 2023-02-08 01:54 | - | |
| The Emoji Movie/ | 2023-02-08 01:54 | - | |
| V.I.P/ | 2023-02-08 21:17 | - | |
| Significant Other/ | 2023-02-08 21:17 | - | |
| The Odds/ | 2023-02-08 21:17 | - | |
| The Survivalist/ | 2023-02-08 21:17 | - | |
| Notre-Dame brule/ | 2023-02-08 21:17 | - | |
| Liu lang di qiu/ | 2023-02-08 21:17 | - | |
| La coartada/ | 2023-02-08 21:17 | - | |
| La consagración de la primavera/ | 2023-02-08 21:17 | - | |
| Legion of Super Heroes/ | 2023-02-08 21:17 | - | |
| Infiesto/ | 2023-02-08 21:35 | - | |
| Háblame de ti/ | 2023-02-08 21:44 | - | |
| Fantasy Football/ | 2023-02-08 21:46 | - | |
| Cita con el crimen/ | 2023-02-08 21:56 | - | |
| Casando a mi ex/ | 2023-02-08 22:06 | - | |
| Aqua Teen Forever Plantasm/ | 2023-02-08 22:06 | - | |
| I Wanna Dance with Somebody/ | 2023-02-09 03:11 | - | |
| Plane (Alerta extrema) (2023)/ | 2023-02-09 03:13 | - | |
| El imperio de la luz/ | 2023-02-09 03:16 | - | |
| The Locksmith/ | 2023-02-10 04:22 | - | |
| Harley Quinn A Very Problematic Valentines Day Special/ | 2023-02-10 04:23 | - | |
| Dear David/ | 2023-02-10 04:23 | - | |
| Baby Ruby/ | 2023-02-10 04:23 | - | |
| Somebody I Used to Know/ | 2023-02-11 07:45 | - | |
| Your Place or Mine/ | 2023-02-11 07:45 | - | |
| At Midnight/ | 2023-02-11 07:54 | - | |
| Casando a mi Ex/ | 2023-02-11 08:17 | - | |
| Lazarus/ | 2023-02-11 17:18 | - | |
| Valhalla/ | 2023-02-11 17:18 | - | |
| Psycho Storm Chaser/ | 2023-02-11 17:18 | - | |
| Rumba Love/ | 2023-02-11 17:18 | - | |
| Skammerens datter II Slangens gave/ | 2023-02-11 17:18 | - | |
| Waidmannsdank/ | 2023-02-11 17:18 | - | |
| Yagmur Rengi/ | 2023-02-11 17:18 | - | |
| Hotel Coppelia/ | 2023-02-11 17:40 | - | |
| Ashley Jones Is Perfectly Normal/ | 2023-02-11 17:43 | - | |
| Stars Fell on Alabama/ | 2023-02-11 19:34 | - | |
| Cabin Tales/ | 2023-02-11 20:20 | - | |
| Petit mal/ | 2023-02-11 20:20 | - | |
| Sweeter Than Chocolate/ | 2023-02-11 20:20 | - | |
| The Love Club Nicoles Pen Pal/ | 2023-02-11 20:20 | - | |
| Curious Caterer Grilling Season/ | 2023-02-11 20:20 | - | |
| leciones para canallas/ | 2023-02-12 05:16 | - | |
| Host/ | 2023-02-14 20:34 | - | |
| El gran terremoto/ | 2023-02-14 20:34 | - | |
| Socios x accidente/ | 2023-02-14 20:34 | - | |
| A todas partes/ | 2023-02-14 20:34 | - | |
| Karada Sagashi/ | 2023-02-14 20:34 | - | |
| The Son/ | 2023-02-14 20:34 | - | |
| Squared Love All Over Again/ | 2023-02-14 20:34 | - | |
| The Go-Getters/ | 2023-02-14 20:34 | - | |
| A Sunday Affair/ | 2023-02-14 20:44 | - | |
| The Offering/ | 2023-02-14 22:26 | - | |
| Lesson in Murder/ | 2023-02-14 22:29 | - | |
| Portals/ | 2023-02-14 22:29 | - | |
| My Salinger Year/ | 2023-02-14 22:31 | - | |
| Meet Me in Paris/ | 2023-02-14 22:32 | - | |
| Killer Unicorn/ | 2023-02-14 22:33 | - | |
| Mega Lightning (2023)/ | 2023-02-14 22:35 | - | |
| Roe v. Wade (2021)/ | 2023-02-14 22:35 | - | |
| Dos Estaciones/ | 2023-02-14 22:35 | - | |
| Boreal/ | 2023-02-14 22:35 | - | |
| Ashley Jones Is Perfectly Normal (2021)/ | 2023-02-14 22:35 | - | |
| El lado salvaje/ | 2023-02-15 04:47 | - | |
| Malcriados/ | 2023-02-15 21:15 | - | |
| Huesera/ | 2023-02-17 04:53 | - | |
| Plan A/ | 2023-02-17 04:53 | - | |
| The Year of the Shark/ | 2023-02-17 04:53 | - | |
| the equalizer/ | 2023-02-18 08:19 | - | |
| Algo pasa en Las Vegas/ | 2023-02-21 04:37 | - | |
| Perdida/ | 2023-02-21 04:37 | - | |
| Ver Thang Máy (El ascensor del diablo) (2020)/ | 2023-02-21 05:28 | - | |
| Unlocked (Identidad desbloqueada/ | 2023-02-21 05:28 | - | |
| Koma/ | 2023-02-21 05:28 | - | |
| j-hope IN THE BOX/ | 2023-02-21 05:28 | - | |
| Island of Shadows (2020)/ | 2023-02-21 05:28 | - | |
| Identidad Desbloqueada/ | 2023-02-21 05:28 | - | |
| Find Her (2022)/ | 2023-02-21 05:28 | - | |
| Coherence/ | 2023-02-21 05:41 | - | |
| Llaman a la puerta/ | 2023-02-21 18:58 | - | |
| Korea The Never-Ending War (2019)/ | 2023-02-22 05:55 | - | |
| Lullaby (2022)/ | 2023-02-22 05:55 | - | |
| Riotsville, U.S.A. (2022)/ | 2023-02-22 05:55 | - | |
| Women Talking (Ellas hablan) (2022)/ | 2023-02-22 05:55 | - | |
| Maleficio/ | 2023-02-22 06:36 | - | |
| Children of Men/ | 2023-02-22 06:40 | - | |
| Prospect/ | 2023-02-22 06:57 | - | |
| Empire State/ | 2023-02-22 20:13 | - | |
| The Strays/ | 2023-02-22 20:13 | - | |
| Bandslam/ | 2023-02-24 02:50 | - | |
| Call Me Chihiro/ | 2023-02-24 02:50 | - | |
| Bellefond/ | 2023-02-24 02:50 | - | |
| Broadcast Signal Intrusion/ | 2023-02-24 02:50 | - | |
| Dealer (2021)/ | 2023-02-24 02:50 | - | |
| The Bodyguard/ | 2023-02-24 02:50 | - | |
| Spoonful of Sugar (2022)/ | 2023-02-24 02:50 | - | |
| Diabolik/ | 2023-02-24 03:09 | - | |
| Dont Leave Home/ | 2023-02-24 03:10 | - | |
| How to Please a Woman/ | 2023-02-24 03:14 | - | |
| A Brilliant Monster (2018)/ | 2023-02-24 03:16 | - | |
| Night Raiders (2021)/ | 2023-02-24 03:18 | - | |
| Entre les vagues (2021)/ | 2023-02-24 03:37 | - | |
| Liaison/ | 2023-02-25 02:35 | - | |
| Die Hart the Movie/ | 2023-02-25 02:35 | - | |
| The Consultant/ | 2023-02-25 02:35 | - | |
| Bruiser/ | 2023-02-25 02:35 | - | |
| We Have a Ghost/ | 2023-02-25 02:35 | - | |
| Bring the Soul The Movie/ | 2023-02-26 04:29 | - | |
| The Whale/ | 2023-02-26 04:40 | - | |
| LA MOMIA REGRESA/ | 2023-02-28 05:02 | - | |
| Amor bandido/ | 2023-02-28 23:29 | - | |
| A Royal Surprise/ | 2023-02-28 23:29 | - | |
| HORIMIYA/ | 2023-02-28 23:29 | - | |
| Magic Mikes Last Dance/ | 2023-02-28 23:29 | - | |
| Next Level/ | 2023-02-28 23:29 | - | |
| Magic Mike/ | 2023-02-28 23:29 | - | |
| Magic Mike XXL/ | 2023-02-28 23:29 | - | |
| La Absoluta/ | 2023-02-28 23:29 | - | |
| A Man Called Otto/ | 2023-02-28 23:47 | - | |
| We Were Soldiers/ | 2023-03-01 17:36 | - | |
| Snake Eyes/ | 2023-03-01 18:15 | - | |
| enemy at the gates 2001 vose 720p/ | 2023-03-01 19:16 | - | |
| Enemy at the Gates/ | 2023-03-01 19:23 | - | |
| Nocebo/ | 2023-03-01 21:08 | - | |
| Out of the Blue/ | 2023-03-01 21:08 | - | |
| Neneh Superstar/ | 2023-03-01 21:08 | - | |
| Sleepaway Slasher/ | 2023-03-01 21:08 | - | |
| Il buco in testa/ | 2023-03-01 21:08 | - | |
| The Mare/ | 2023-03-01 21:08 | - | |
| The Silent Twins/ | 2023-03-01 21:08 | - | |
| Gods Country/ | 2023-03-01 21:26 | - | |
| Esta noche duermes conmigo/ | 2023-03-01 21:30 | - | |
| Cryptid/ | 2023-03-01 21:31 | - | |
| Candy Land/ | 2023-03-01 21:31 | - | |
| 12 Theses/ | 2023-03-01 21:32 | - | |
| Princess Khutulun/ | 2023-03-03 02:59 | - | |
| Folie A Famille (2023)/ | 2023-03-03 03:06 | - | |
| Donnie Darko/ | 2023-03-03 04:02 | - | |
| TRIANGLE/ | 2023-03-03 04:02 | - | |
| FateGrand Order First Order/ | 2023-03-03 04:25 | - | |
| FateGrand Order Moonlight Lostroom/ | 2023-03-03 04:27 | - | |
| FateGrand Order Zettai Majuu Sensen Babylonia/ | 2023-03-03 04:31 | - | |
| 10 DÍAS DE UN BUEN HOMBRE/ | 2023-03-04 06:20 | - | |
| A Dennis the Menace Christmas/ | 2023-03-04 06:20 | - | |
| Assassins/ | 2023-03-04 06:20 | - | |
| Beyond the Line/ | 2023-03-04 06:20 | - | |
| Equal Standard/ | 2023-03-04 06:23 | - | |
| Eres tu/ | 2023-03-04 06:26 | - | |
| Heojil kyolshim/ | 2023-03-04 06:28 | - | |
| Sayen/ | 2023-03-04 06:29 | - | |
| Triangle of Sadness/ | 2023-03-04 06:30 | - | |
| 13 exorcismos/ | 2023-03-07 05:37 | - | |
| A Waltons Thanksgiving (2022)/ | 2023-03-07 05:51 | - | |
| Cocaine Bear (2023)/ | 2023-03-07 05:51 | - | |
| Nightmare Neighborhood Moms (2022)/ | 2023-03-07 05:51 | - | |
| Hilma (2022)/ | 2023-03-07 05:51 | - | |
| Snow Day/ | 2023-03-07 06:07 | - | |
| Suki/ | 2023-03-07 06:07 | - | |
| Malvada/ | 2023-03-08 21:03 | - | |
| ONE PIECE FILM RED/ | 2023-03-09 05:45 | - | |
| Marlowe/ | 2023-03-09 05:53 | - | |
| Widows/ | 2023-03-10 00:42 | - | |
| Faraway/ | 2023-03-10 07:48 | - | |
| The Integrity of Joseph Chambers/ | 2023-03-10 07:51 | - | |
| The Tigers Nest/ | 2023-03-10 07:51 | - | |
| The Wall/ | 2023-03-10 07:51 | - | |
| The Walk/ | 2023-03-10 07:51 | - | |
| Living/ | 2023-03-10 07:53 | - | |
| Dead for a Dollar/ | 2023-03-10 08:06 | - | |
| Coffee Wars/ | 2023-03-10 08:09 | - | |
| Chris Rock Selective Outrage/ | 2023-03-10 08:09 | - | |
| Armageddon Time/ | 2023-03-10 08:10 | - | |
| On the Come Up/ | 2023-03-10 08:14 | - | |
| Les Passagers de la nuit/ | 2023-03-10 08:17 | - | |
| Ghosts of the Ozarks/ | 2023-03-10 08:21 | - | |
| 80 for Brady (2023/ | 2023-03-11 04:42 | - | |
| Encontro lo que buscaba/ | 2023-03-11 04:42 | - | |
| Have.a.nice.day.10/ | 2023-03-11 04:42 | - | |
| Luther.The.Fallen.Sun.2023/ | 2023-03-11 04:42 | - | |
| Operation Fortune Ruse de Guerre/ | 2023-03-11 04:42 | - | |
| Sharpay s Fabulous Adventure/ | 2023-03-11 05:42 | - | |
| Mortal Kombat Annihilation (1997)/ | 2023-03-11 18:58 | - | |
| Chasing Papi (2003)/ | 2023-03-11 18:58 | - | |
| Dragon Blade (2015)/ | 2023-03-11 18:58 | - | |
| Friends with Benefits (2011)/ | 2023-03-11 18:58 | - | |
| Going the Distance (2010)/ | 2023-03-11 18:58 | - | |
| Mortal Kombat (1995)/ | 2023-03-11 18:58 | - | |
| Mars Attacks(1996)/ | 2023-03-11 18:58 | - | |
| La.farsa.2022/ | 2023-03-11 18:58 | - | |
| Melancholia(2011)/ | 2023-03-11 18:58 | - | |
| Tangos tequilas y algunas mentiras2023/ | 2023-03-11 18:58 | - | |
| Two Girls and a Guy(1997)/ | 2023-03-11 19:47 | - | |
| Chang Can Dunk (2023)/ | 2023-03-11 20:02 | - | |
| Into the Wild/ | 2023-03-11 20:22 | - | |
| Jurassic Park/ | 2026-05-19 01:27 | - | |
|
|---|